3-Methyl-1-(3'-sulfoamidophenyl)-5-pyrazolone
3-Methyl-1-(3'-sulfoamidophenyl)-5-pyrazolone structure
|
Common Name | 3-Methyl-1-(3'-sulfoamidophenyl)-5-pyrazolone | ||
|---|---|---|---|---|
| CAS Number | 89-29-2 | Molecular Weight | 253.27800 | |
| Density | 1.52 g/cm3 | Boiling Point | 541.6ºC at 760 mmHg | |
| Molecular Formula | C10H11N3O3S | Melting Point | 202-206 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 281.4ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-Methyl-1-(3'-sulfoamidophenyl)-5-pyrazolone |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.52 g/cm3 |
|---|---|
| Boiling Point | 541.6ºC at 760 mmHg |
| Melting Point | 202-206 °C(lit.) |
| Molecular Formula | C10H11N3O3S |
| Molecular Weight | 253.27800 |
| Flash Point | 281.4ºC |
| Exact Mass | 253.05200 |
| PSA | 101.21000 |
| LogP | 1.72830 |
| Index of Refraction | 1.684 |
| InChIKey | ASVVGQURNHNITH-UHFFFAOYSA-N |
| SMILES | CC1=NN(c2cccc(S(N)(=O)=O)c2)C(=O)C1 |
This table provides MSDS information including hazard classification, first‑aid, fire‑fighting, spill handling, operation and storage instructions.
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 1 |
| HS Code | 2935009090 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 2 | |
CAS#:184707-71-9
CAS#:578-54-1This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| EINECS 201-895-2 |
| 3-(3-methyl-5-oxo-4H-pyrazol-1-yl)benzenesulfonamide |
| MFCD00035707 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the safety information for 3-Methyl-1-(3'-sulfoamidophenyl)-5-pyrazolone? |
| A: Safety information for 3-Methyl-1-(3'-sulfoamidophenyl)-5-pyrazolone: S26-S36. |
| Q: What is the molecular formula of 3-Methyl-1-(3'-sulfoamidophenyl)-5-pyrazolone? |
| A: Molecular formula of 3-Methyl-1-(3'-sulfoamidophenyl)-5-pyrazolone is C10H11N3O3S. |
| Q: What is the melting point of 3-Methyl-1-(3'-sulfoamidophenyl)-5-pyrazolone? |
| A: Melting point of 3-Methyl-1-(3'-sulfoamidophenyl)-5-pyrazolone is 202-206 °C(lit.). |
| Q: What is the LogP of 3-Methyl-1-(3'-sulfoamidophenyl)-5-pyrazolone? |
| A: LogP of 3-Methyl-1-(3'-sulfoamidophenyl)-5-pyrazolone is 1.72830. |
| Q: What is the boiling point of 3-Methyl-1-(3'-sulfoamidophenyl)-5-pyrazolone? |
| A: Boiling point of 3-Methyl-1-(3'-sulfoamidophenyl)-5-pyrazolone is 541.6ºC at 760 mmHg. |
| Q: What is the polar surface area (PSA) of 3-Methyl-1-(3'-sulfoamidophenyl)-5-pyrazolone? |
| A: Polar surface area (PSA) of 3-Methyl-1-(3'-sulfoamidophenyl)-5-pyrazolone is 101.21000. |
| Q: What is the molecular weight of 3-Methyl-1-(3'-sulfoamidophenyl)-5-pyrazolone? |
| A: Molecular weight of 3-Methyl-1-(3'-sulfoamidophenyl)-5-pyrazolone is 253.27800. |
| Q: What is the InChIKey of 3-Methyl-1-(3'-sulfoamidophenyl)-5-pyrazolone? |
| A: InChIKey of 3-Methyl-1-(3'-sulfoamidophenyl)-5-pyrazolone is ASVVGQURNHNITH-UHFFFAOYSA-N. |
| Q: What is the CAS number of 3-Methyl-1-(3'-sulfoamidophenyl)-5-pyrazolone? |
| A: CAS number of 3-Methyl-1-(3'-sulfoamidophenyl)-5-pyrazolone is 89-29-2. |
| Q: What are the downstream products of 3-Methyl-1-(3'-sulfoamidophenyl)-5-pyrazolone? |
| A: Related downstream products(CAS) of 3-Methyl-1-(3'-sulfoamidophenyl)-5-pyrazolone: 184707-71-9;578-54-1. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |