3-Methyl-1-(4-sulfophenyl)-2-pyrazolin-5-one structure
|
Common Name | 3-Methyl-1-(4-sulfophenyl)-2-pyrazolin-5-one | ||
|---|---|---|---|---|
| CAS Number | 89-36-1 | Molecular Weight | 254.262 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 477ºC | |
| Molecular Formula | C10H10N2O4S | Melting Point | >252 °C (dec.)(lit.) | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS05 |
Signal Word | Danger | |
| Name | 3-Methyl-1-(4-sulfophenyl)-2-pyrazolin-5-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 477ºC |
| Melting Point | >252 °C (dec.)(lit.) |
| Molecular Formula | C10H10N2O4S |
| Molecular Weight | 254.262 |
| Exact Mass | 254.036133 |
| PSA | 95.42000 |
| LogP | -1.31 |
| Index of Refraction | 1.667 |
| InChIKey | CWJQQASJVVAXKL-UHFFFAOYSA-N |
| SMILES | CC1=NN(c2ccc(S(=O)(=O)O)cc2)C(=O)C1 |
| Water Solubility | 5 g/L (20 ºC) |
| Symbol |
GHS05 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H314 |
| Precautionary Statements | P280-P305 + P351 + P338-P310 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P3 (EN 143) respirator cartridges |
| Hazard Codes | C:Corrosive; |
| Risk Phrases | R34 |
| Safety Phrases | S26-S36/37/39-S45 |
| RIDADR | UN 1759 8/PG 2 |
| WGK Germany | 1 |
| Hazard Class | 8.0 |
| HS Code | 2933199090 |
|
~%
3-Methyl-1-(4-s... CAS#:89-36-1 |
| Literature: Chemistry and Biology, , vol. 17, # 5 p. 471 - 482 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
Determination of galactose and mannose residues in natural galactomannans using a fast and efficient high-performance liquid chromatography/UV detection.
J. Chromatogr. A. 1181(1-2) , 45-50, (2008) The present work describes the validation of an easy, fast and efficient precolumn derivatization method for the quantification of oligosides, mannose and galactose obtained by degradation of galactom... |
|
|
Precolumn derivatization of reducing carbohydrates with 4-(3-methyl-5-oxo-2-pyrazolin-1-yl) benzoic acid. Study of reaction, high-performance liquid chromatographic separation and quantitative performance of method. Castells CB, et al.
Chromatographia 56(3-4) , 153-160, (2002)
|
| 4-(3-methyl-5-oxo-4,5-dihydropyrazol-1-yl)benzenesulfonic acid |
| 4-(4,5-dihydro-3-methyl-5-oxo-1H-pyrazol-1-yl)-benzenesulfonic acid |
| 4-(3-Methyl-5-oxo-4,5-dihydro-1H-pyrazol-1-yl)benzenesulfonic acid |
| PSMP |
| MFCD00020756 |
| SPMP |
| 1-(4-sulfophenyl)-3-methyl-2-pyrazoline-5-one |
| 1-(p-Sulfophenyl)-3-methyl-pyrazolon-(5) |
| 1-(4-Sulfophenyl)-3-methyl-5-p |
| 4-PYRAZOLIC ACID |
| 4-acid pyrazolone |
| EINECS 201-901-3 |
| PYRAZOLINE G |
| 4-(3-Methyl-5-oxo-2-pyrazolin-1-yl)benzolsulfonsaeure |
| 1-(4-Sulphophenyl)-3-methyl-5-pyrazolone |
| PHENYLMETHYLPYRAZOLE-4-ACID |
| 4-(3-methyl-5-oxo-2,5-dihydro-pyrazol-1-yl)-benzenesulfonic acid |
| p-SMP (1 : 4 SPMP) |
| PYRAZOLONE G |
| Pyrazolic acid |