1,4-DIMETHOXY-2-NITROBENZENE structure
|
Common Name | 1,4-DIMETHOXY-2-NITROBENZENE | ||
|---|---|---|---|---|
| CAS Number | 89-39-4 | Molecular Weight | 183.16100 | |
| Density | 1.226g/cm3 | Boiling Point | 169ºC / 13mmHg | |
| Molecular Formula | C8H9NO4 | Melting Point | 72ºC | |
| MSDS | N/A | Flash Point | 156.7ºC | |
| Name | 1,4-Dimethoxy-2-nitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.226g/cm3 |
|---|---|
| Boiling Point | 169ºC / 13mmHg |
| Melting Point | 72ºC |
| Molecular Formula | C8H9NO4 |
| Molecular Weight | 183.16100 |
| Flash Point | 156.7ºC |
| Exact Mass | 183.05300 |
| PSA | 64.28000 |
| LogP | 2.13520 |
| Index of Refraction | 1.53 |
| InChIKey | UPTOWXNJLZJTGD-UHFFFAOYSA-N |
| SMILES | COc1ccc(OC)c([N+](=O)[O-])c1 |
| HS Code | 2909309090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 9 | |
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| 1,4-dimethoxy-2-nitrobenzene |
| EINECS 201-903-4 |
| MFCD00024211 |