2,5-Dimethoxy-4-nitroaniline structure
|
Common Name | 2,5-Dimethoxy-4-nitroaniline | ||
|---|---|---|---|---|
| CAS Number | 6313-37-7 | Molecular Weight | 198.17600 | |
| Density | 1.307 g/cm3 | Boiling Point | 401.5ºC at 760 mmHg | |
| Molecular Formula | C8H10N2O4 | Melting Point | 152-155 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 196.6ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 2,5-Dimethoxy-4-nitroaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.307 g/cm3 |
|---|---|
| Boiling Point | 401.5ºC at 760 mmHg |
| Melting Point | 152-155 °C(lit.) |
| Molecular Formula | C8H10N2O4 |
| Molecular Weight | 198.17600 |
| Flash Point | 196.6ºC |
| Exact Mass | 198.06400 |
| PSA | 90.30000 |
| LogP | 2.29860 |
| Index of Refraction | 1.579 |
| InChIKey | ZTQGTYFYOODGOQ-UHFFFAOYSA-N |
| SMILES | COc1cc([N+](=O)[O-])c(OC)cc1N |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302 + H312 + H332 |
| Precautionary Statements | P280 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xn:Harmful; |
| Risk Phrases | R20/21/22 |
| Safety Phrases | S36-S36/37 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| Packaging Group | I; II; III |
| Hazard Class | 6.1 |
| HS Code | 2922299090 |
|
~67%
2,5-Dimethoxy-4... CAS#:6313-37-7 |
| Literature: Journal of the American Chemical Society, , vol. 135, # 13 p. 5000 - 5003 |
|
~99%
2,5-Dimethoxy-4... CAS#:6313-37-7 |
| Literature: Jackson, Yvette A.; Lyon, Michael A.; Townsend, Norman; Bellabe, Kettyna; Soltanik, Fernando Journal of the Chemical Society, Perkin Transactions 1, 2000 , # 2 p. 205 - 210 |
|
~%
2,5-Dimethoxy-4... CAS#:6313-37-7 |
| Literature: US2056255 , ; |
|
~%
2,5-Dimethoxy-4... CAS#:6313-37-7 |
| Literature: Journal of the Chemical Society, Perkin Transactions 1, , # 2 p. 205 - 210 |
|
~%
2,5-Dimethoxy-4... CAS#:6313-37-7 |
| Literature: Journal of the Chemical Society, Perkin Transactions 1, , # 2 p. 205 - 210 |
|
~%
2,5-Dimethoxy-4... CAS#:6313-37-7 |
| Literature: DE141398 ; |
|
~%
2,5-Dimethoxy-4... CAS#:6313-37-7 |
| Literature: US2056255 , ; |
|
~%
2,5-Dimethoxy-4... CAS#:6313-37-7 |
| Literature: Journal of the Chemical Society, , vol. 127, p. 2003 |
| Precursor 7 | |
|---|---|
| DownStream 4 | |
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|
Acetyl-coenzyme A: arylamine N-acetyltransferases in microorganisms: screening and isolation of an enzyme from Bacillus cereus.
Arch. Microbiol. 146(3) , 275-9, (1986) The raw extracts of a series of microorganisms were screened for the presence of acetyl-coenzyme A: arylamine N-acetyltransferase (AAAT) using a radioactive assay with 3H-acetyl-coenzyme A and aniline... |
| Benzenamine,2,5-dimethoxy-4-nitro |
| 2,4-DIMETHOXY-3-METHYL-5-NITRO-PHENYLAMINE |
| 2,5-Dimethoxy-4-nitro-anilin |
| 2,5-dimethoxy-para-nitroaniline |
| 1-amino-2,5-dimethoxy-4-nitrobenzene |
| MFCD00007361 |
| 5-nitro-2-amino-1,4-dimethoxy-benzene |
| 3,6-Dimethoxy-4-nitroaniline |
| EINECS 228-640-8 |
| 2,5-dimethoxy-4-nitrophenylamine |
| 2,5-dimethoxy-4-nitro-aniline |
| 2,5-dimethoxy-4-amino-1-nitrobenzene |