[1-(benzenesulfinyl)-3-methylbuta-1,2-dienyl]sulfanylbenzene structure
|
Common Name | [1-(benzenesulfinyl)-3-methylbuta-1,2-dienyl]sulfanylbenzene | ||
|---|---|---|---|---|
| CAS Number | 89005-20-9 | Molecular Weight | 300.43800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H16OS2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [1-(benzenesulfinyl)-3-methylbuta-1,2-dienyl]sulfanylbenzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H16OS2 |
|---|---|
| Molecular Weight | 300.43800 |
| Exact Mass | 300.06400 |
| PSA | 61.58000 |
| LogP | 5.85870 |
| InChIKey | JUKSBAJCCVDTCN-UHFFFAOYSA-N |
| SMILES | CC(C)=C=C(Sc1ccccc1)S(=O)c1ccccc1 |
|
~56%
[1-(benzenesulf... CAS#:89005-20-9 |
| Literature: Cutting, Ian; Parsons, Philip J. Journal of the Chemical Society, Chemical Communications, 1983 , # 21 p. 1209 - 1210 |
| Precursor 2 | |
|---|---|
| DownStream 7 | |
| Benzene,[[3-methyl-1-(phenylsulfinyl)-1,2-butadienyl]thio] |