1-[2-chloro-2-(4-methylphenyl)ethyl]sulfanyl-2,4-dinitrobenzene structure
|
Common Name | 1-[2-chloro-2-(4-methylphenyl)ethyl]sulfanyl-2,4-dinitrobenzene | ||
|---|---|---|---|---|
| CAS Number | 89039-18-9 | Molecular Weight | 352.79300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H13ClN2O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-[2-chloro-2-(4-methylphenyl)ethyl]sulfanyl-2,4-dinitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H13ClN2O4S |
|---|---|
| Molecular Weight | 352.79300 |
| Exact Mass | 352.02800 |
| PSA | 116.94000 |
| LogP | 5.93000 |
| InChIKey | DTLNPYRFHBDRNV-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C(Cl)CSc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])cc1 |
|
~%
1-[2-chloro-2-(... CAS#:89039-18-9 |
| Literature: Kanska, Marianna; Fry, Arthur Journal of the American Chemical Society, 1983 , vol. 105, # 26 p. 7666 - 7672 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Benzene,1-[[2-chloro-2-(4-methylphenyl)ethyl]thio]-2,4-dinitro |