1-(4-fluorophenyl)-3,5-dimethylpyrazole-4-carbaldehyde structure
|
Common Name | 1-(4-fluorophenyl)-3,5-dimethylpyrazole-4-carbaldehyde | ||
|---|---|---|---|---|
| CAS Number | 890626-54-7 | Molecular Weight | 218.22700 | |
| Density | 1.19g/cm3 | Boiling Point | 335ºC at 760 mmHg | |
| Molecular Formula | C12H11FN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 156.4ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 1-(4-fluorophenyl)-3,5-dimethylpyrazole-4-carbaldehyde |
|---|---|
| Synonym | More Synonyms |
| Density | 1.19g/cm3 |
|---|---|
| Boiling Point | 335ºC at 760 mmHg |
| Molecular Formula | C12H11FN2O |
| Molecular Weight | 218.22700 |
| Flash Point | 156.4ºC |
| Exact Mass | 218.08600 |
| PSA | 34.89000 |
| LogP | 2.44070 |
| Index of Refraction | 1.571 |
| InChIKey | AXOXHQSHPSKAID-UHFFFAOYSA-N |
| SMILES | Cc1nn(-c2ccc(F)cc2)c(C)c1C=O |
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| bb_sc-3641 |