4(3H)-Pyrimidinone,3-(3-methoxyphenyl)-2-(methylthio)- structure
|
Common Name | 4(3H)-Pyrimidinone,3-(3-methoxyphenyl)-2-(methylthio)- | ||
|---|---|---|---|---|
| CAS Number | 89069-27-2 | Molecular Weight | 248.30100 | |
| Density | 1.23g/cm3 | Boiling Point | 404.6ºC at 760mmHg | |
| Molecular Formula | C12H12N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 198.5ºC | |
| Name | 3-(3-methoxyphenyl)-2-methylsulfanylpyrimidin-4-one |
|---|
| Density | 1.23g/cm3 |
|---|---|
| Boiling Point | 404.6ºC at 760mmHg |
| Molecular Formula | C12H12N2O2S |
| Molecular Weight | 248.30100 |
| Flash Point | 198.5ºC |
| Exact Mass | 248.06200 |
| PSA | 69.42000 |
| LogP | 1.96300 |
| Index of Refraction | 1.607 |
| InChIKey | OJFOMYWZQKHGOT-UHFFFAOYSA-N |
| SMILES | COc1cccc(-n2c(SC)nccc2=O)c1 |
|
~59%
4(3H)-Pyrimidin... CAS#:89069-27-2 |
| Literature: Gupta, K. A.; Saxena, Anil K.; Jain, Padam C.; Dua, P. R.; Prasad, C. R.; Anand, Nitya Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1983 , vol. 22, # 8 p. 789 - 794 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |