ethyl 4-(3-methylbut-2-enoxy)benzoate structure
|
Common Name | ethyl 4-(3-methylbut-2-enoxy)benzoate | ||
|---|---|---|---|---|
| CAS Number | 89091-82-7 | Molecular Weight | 234.29100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H18O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl 4-(3-methylbut-2-enoxy)benzoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H18O3 |
|---|---|
| Molecular Weight | 234.29100 |
| Exact Mass | 234.12600 |
| PSA | 35.53000 |
| LogP | 3.20830 |
| InChIKey | YDWCAKNWVJGJRY-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1ccc(OCC=C(C)C)cc1 |
|
~94%
ethyl 4-(3-meth... CAS#:89091-82-7 |
| Literature: ASTEX THERAPEUTICS LIMITED Patent: WO2008/44041 A1, 2008 ; Location in patent: Page/Page column 213 ; |
|
~%
ethyl 4-(3-meth... CAS#:89091-82-7 |
| Literature: Lauer; Moe Journal of the American Chemical Society, 1943 , vol. 65, p. 289,292 |
| Benzoic acid,4-[(3-methyl-2-butenyl)oxy]-,ethyl ester |
| ethyl 4-(3-methyl-but-2-enyloxy)-benzoate |
| 4-(3-methyl-but-2-enyloxy)-benzoic acid ethyl ester |
| 4-(3-Methyl-but-2-enyloxy)-benzoesaeure-aethylester |