1-propan-2-yl-1,4,4a,9a-tetrahydroanthracene-9,10-dione structure
|
Common Name | 1-propan-2-yl-1,4,4a,9a-tetrahydroanthracene-9,10-dione | ||
|---|---|---|---|---|
| CAS Number | 89115-85-5 | Molecular Weight | 254.32400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H18O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-propan-2-yl-1,4,4a,9a-tetrahydroanthracene-9,10-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H18O2 |
|---|---|
| Molecular Weight | 254.32400 |
| Exact Mass | 254.13100 |
| PSA | 34.14000 |
| LogP | 3.53010 |
| InChIKey | HOZIFJRRYKRAPB-UHFFFAOYSA-N |
| SMILES | CC(C)C1C=CCC2C(=O)c3ccccc3C(=O)C21 |
|
~49%
1-propan-2-yl-1... CAS#:89115-85-5 |
| Literature: Ito, Yoshikatsu; Inada, Norio; Matsuura, Teruo Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1983 , # 12 p. 1857 - 1862 |
| 9,10-Anthracenedione,1,4,4a,9a-tetrahydro-1-(1-methylethyl) |