1-propan-2-yl-1,4,4a,9a-tetrahydroanthracene-9,10-dione
1-propan-2-yl-1,4,4a,9a-tetrahydroanthracene-9,10-dione structure
|
Common Name | 1-propan-2-yl-1,4,4a,9a-tetrahydroanthracene-9,10-dione | ||
|---|---|---|---|---|
| CAS Number | 89115-85-5 | Molecular Weight | 254.32400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H18O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: 1-Propan-2-yl-1,4,4a,9a-tetrahydroanthracene-9,10-dione (Chinese name: 1-丙基蒽醌-9,10-二酮), CAS number: 89115-85-5, molecular formula: C17H18O2, molecular weight: 254.32400. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-propan-2-yl-1,4,4a,9a-tetrahydroanthracene-9,10-dione |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C17H18O2 |
|---|---|
| Molecular Weight | 254.32400 |
| Exact Mass | 254.13100 |
| PSA | 34.14000 |
| LogP | 3.53010 |
| InChIKey | HOZIFJRRYKRAPB-UHFFFAOYSA-N |
| SMILES | CC(C)C1C=CCC2C(=O)c3ccccc3C(=O)C21 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~49%
1-propan-2-yl-1... CAS#:89115-85-5 |
| Literature: Ito, Yoshikatsu; Inada, Norio; Matsuura, Teruo Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1983 , # 12 p. 1857 - 1862 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 3 | |
CAS#:89115-87-7
CAS#:89115-88-8
CAS#:52868-95-8This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 9,10-Anthracenedione,1,4,4a,9a-tetrahydro-1-(1-methylethyl) |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 1-propan-2-yl-1,4,4a,9a-tetrahydroanthracene-9,10-dione? |
| A: InChIKey of 1-propan-2-yl-1,4,4a,9a-tetrahydroanthracene-9,10-dione is HOZIFJRRYKRAPB-UHFFFAOYSA-N. |
| Q: What is the LogP of 1-propan-2-yl-1,4,4a,9a-tetrahydroanthracene-9,10-dione? |
| A: LogP of 1-propan-2-yl-1,4,4a,9a-tetrahydroanthracene-9,10-dione is 3.53010. |
| Q: What are the upstream materials of 1-propan-2-yl-1,4,4a,9a-tetrahydroanthracene-9,10-dione? |
| A: Related upstream materials(CAS) of 1-propan-2-yl-1,4,4a,9a-tetrahydroanthracene-9,10-dione: 32763-70-5;130-15-4. |
| Q: What are the downstream products of 1-propan-2-yl-1,4,4a,9a-tetrahydroanthracene-9,10-dione? |
| A: Related downstream products(CAS) of 1-propan-2-yl-1,4,4a,9a-tetrahydroanthracene-9,10-dione: 89115-87-7;89115-88-8;52868-95-8. |
| Q: What is the Chinese name of 89115-85-5? |
| A: Chinese name of 89115-85-5 is 89115-85-5. |
| Q: What is the CAS number of 1-propan-2-yl-1,4,4a,9a-tetrahydroanthracene-9,10-dione? |
| A: CAS number of 1-propan-2-yl-1,4,4a,9a-tetrahydroanthracene-9,10-dione is 89115-85-5. |
| Q: What is the SMILES notation of 1-propan-2-yl-1,4,4a,9a-tetrahydroanthracene-9,10-dione? |
| A: SMILES notation of 1-propan-2-yl-1,4,4a,9a-tetrahydroanthracene-9,10-dione is CC(C)C1C=CCC2C(=O)c3ccccc3C(=O)C21. |
| Q: What is the molecular formula of 1-propan-2-yl-1,4,4a,9a-tetrahydroanthracene-9,10-dione? |
| A: Molecular formula of 1-propan-2-yl-1,4,4a,9a-tetrahydroanthracene-9,10-dione is C17H18O2. |
| Q: What is the molecular weight of 1-propan-2-yl-1,4,4a,9a-tetrahydroanthracene-9,10-dione? |
| A: Molecular weight of 1-propan-2-yl-1,4,4a,9a-tetrahydroanthracene-9,10-dione is 254.32400. |
| Q: What is the polar surface area (PSA) of 1-propan-2-yl-1,4,4a,9a-tetrahydroanthracene-9,10-dione? |
| A: Polar surface area (PSA) of 1-propan-2-yl-1,4,4a,9a-tetrahydroanthracene-9,10-dione is 34.14000. |