Mca-Pro-Leu-Gly-Leu-Glu-Glu-Ala-Dap(Dnp)-NH2 trifluoroacetate salt structure
|
Common Name | Mca-Pro-Leu-Gly-Leu-Glu-Glu-Ala-Dap(Dnp)-NH2 trifluoroacetate salt | ||
|---|---|---|---|---|
| CAS Number | 891198-38-2 | Molecular Weight | 1195.19000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C53H70N12O20 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Mca-Pro-Leu-Gly-Leu-Glu-Glu-Ala-Dap(Dnp)-NH2 trifluoroacetate saltMca-Pro-Leu-Gly-Leu-Glu-Glu-Ala-Dap(Dnp)-NH2 is highly selective substrate for matrix metalloproteases 12 (MMP12) substrate with a kcat/Km value of 1.85*105 M-1s-1, and poor substrate of other MMPs with the exception of MMP13 (kcat/Km = 0.53*105 M-1s-1) and MMP9 (0.33*105 M-1s-1)[1]. |
| Name | L-Alaninamide, 1-[(7-methoxy-2-oxo-2H-1-benzopyran-4-yl)acetyl]-L-prolyl-L-leucylglycyl-L-leucyl-L-α-glutamyl-L-α-glutamyl-L-alanyl-3-[(2,4-dinitrophenyl)amino] |
|---|---|
| Synonym | More Synonyms |
| Description | Mca-Pro-Leu-Gly-Leu-Glu-Glu-Ala-Dap(Dnp)-NH2 is highly selective substrate for matrix metalloproteases 12 (MMP12) substrate with a kcat/Km value of 1.85*105 M-1s-1, and poor substrate of other MMPs with the exception of MMP13 (kcat/Km = 0.53*105 M-1s-1) and MMP9 (0.33*105 M-1s-1)[1]. |
|---|---|
| Related Catalog | |
| Target |
others |
| References |
| Molecular Formula | C53H70N12O20 |
|---|---|
| Molecular Weight | 1195.19000 |
| Exact Mass | 1194.48000 |
| PSA | 484.81000 |
| LogP | 4.10950 |
| InChIKey | IUIVVOHCYZAJIV-PFQABZGHSA-N |
| SMILES | COc1ccc2c(CC(=O)N3CCCC3C(=O)NC(CC(C)C)C(=O)NCC(=O)NC(CC(C)C)C(=O)NC(CCC(=O)O)C(=O)NC(CCC(=O)O)C(=O)NC(C)C(=O)NC(CNc3ccc([N+](=O)[O-])cc3[N+](=O)[O-])C(N)=O)cc(=O)oc2c1 |
| Mca-Pro-Leu-Gly-Leu-Glu-Glu-Ala-Dap(Dnp)-NH2 |
| 390 MMP FRET SUBSTRATE (V) |