6-methyl-2,5-dihydro-1H-pyrrolo[3,4-c]pyridine-3,4-dione,sulfuric acid
![6-methyl-2,5-dihydro-1H-pyrrolo[3,4-c]pyridine-3,4-dione,sulfuric acid Structure](https://image.chemsrc.com/caspic/129/89159-35-3.png)
6-methyl-2,5-dihydro-1H-pyrrolo[3,4-c]pyridine-3,4-dione,sulfuric acid structure
|
Common Name | 6-methyl-2,5-dihydro-1H-pyrrolo[3,4-c]pyridine-3,4-dione,sulfuric acid | ||
|---|---|---|---|---|
| CAS Number | 89159-35-3 | Molecular Weight | 426.40100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H18N4O8S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 6-methyl-2,5-dihydro-1H-pyrrolo[3,4-c]pyridine-3,4-dione,sulfuric acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H18N4O8S |
|---|---|
| Molecular Weight | 426.40100 |
| Exact Mass | 426.08500 |
| PSA | 214.40000 |
| LogP | 1.12680 |
| InChIKey | DGLOOACTZDYGAP-UHFFFAOYSA-N |
| SMILES | Cc1cc2c(c(=O)[nH]1)C(=O)NC2.Cc1cc2c(c(=O)[nH]1)C(=O)NC2.O=S(=O)(O)O |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~51%
6-methyl-2,5-di... CAS#:89159-35-3 |
| Literature: Shul'ga, N. A.; Balyakina, M. V.; Gunar, V. I. Pharmaceutical Chemistry Journal, 1983 , vol. 17, # 9 p. 665 - 669 Khimiko-Farmatsevticheskii Zhurnal, 1983 , vol. 17, # 9 p. 1111 - 1115 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Bis-(6-methyl-1H-pyrrolo[3,4-c]pyridine-3,4(2H |
| Bis-<6-methyl-1H-pyrrolo<3,4-c>pyridine-3,4(2H,5H)-dione> sulfate |
| 5H)-dione) sulfate |
| 1H-Pyrrolo[3,4-c]pyridine-3,4(2H,5H)-dione,6-methyl-,sulfate (2:1) |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 6-methyl-2,5-dihydro-1H-pyrrolo[3,4-c]pyridine-3,4-dione,sulfuric acid? |
| A: The English name of 6-methyl-2,5-dihydro-1H-pyrrolo[3,4-c]pyridine-3,4-dione,sulfuric acid is 6-methyl-2,5-dihydro-1H-pyrrolo[3,4-c]pyridine-3,4-dione,sulfuric acid. |
| Q: What is the polar surface area (PSA) of 6-methyl-2,5-dihydro-1H-pyrrolo[3,4-c]pyridine-3,4-dione,sulfuric acid? |
| A: Polar surface area (PSA) of 6-methyl-2,5-dihydro-1H-pyrrolo[3,4-c]pyridine-3,4-dione,sulfuric acid is 214.40000. |
| Q: What English synonyms does 6-methyl-2,5-dihydro-1H-pyrrolo[3,4-c]pyridine-3,4-dione,sulfuric acid have? |
| A: English synonyms of 6-methyl-2,5-dihydro-1H-pyrrolo[3,4-c]pyridine-3,4-dione,sulfuric acid: Bis-(6-methyl-1H-pyrrolo[3,4-c]pyridine-3,4(2H, Bis-<6-methyl-1H-pyrrolopyridine-3,4(2H,5H)-dione> sulfate, 5H)-dione) sulfate, 1H-Pyrrolo[3,4-c]pyridine-3,4(2H,5H)-dione,6-methyl-,sulfate (2:1). |
| Q: What are the upstream materials of 6-methyl-2,5-dihydro-1H-pyrrolo[3,4-c]pyridine-3,4-dione,sulfuric acid? |
| A: Related upstream materials(CAS) of 6-methyl-2,5-dihydro-1H-pyrrolo[3,4-c]pyridine-3,4-dione,sulfuric acid: 6339-38-4. |
| Q: What is the molecular weight of 6-methyl-2,5-dihydro-1H-pyrrolo[3,4-c]pyridine-3,4-dione,sulfuric acid? |
| A: Molecular weight of 6-methyl-2,5-dihydro-1H-pyrrolo[3,4-c]pyridine-3,4-dione,sulfuric acid is 426.40100. |
| Q: What is the Chinese name of 89159-35-3? |
| A: Chinese name of 89159-35-3 is 89159-35-3. |
| Q: What is the InChIKey of 6-methyl-2,5-dihydro-1H-pyrrolo[3,4-c]pyridine-3,4-dione,sulfuric acid? |
| A: InChIKey of 6-methyl-2,5-dihydro-1H-pyrrolo[3,4-c]pyridine-3,4-dione,sulfuric acid is DGLOOACTZDYGAP-UHFFFAOYSA-N. |
| Q: What is the LogP of 6-methyl-2,5-dihydro-1H-pyrrolo[3,4-c]pyridine-3,4-dione,sulfuric acid? |
| A: LogP of 6-methyl-2,5-dihydro-1H-pyrrolo[3,4-c]pyridine-3,4-dione,sulfuric acid is 1.12680. |
| Q: What is the SMILES notation of 6-methyl-2,5-dihydro-1H-pyrrolo[3,4-c]pyridine-3,4-dione,sulfuric acid? |
| A: SMILES notation of 6-methyl-2,5-dihydro-1H-pyrrolo[3,4-c]pyridine-3,4-dione,sulfuric acid is Cc1cc2c(c(=O)[nH]1)C(=O)NC2.Cc1cc2c(c(=O)[nH]1)C(=O)NC2.O=S(=O)(O)O. |
| Q: What is the molecular formula of 6-methyl-2,5-dihydro-1H-pyrrolo[3,4-c]pyridine-3,4-dione,sulfuric acid? |
| A: Molecular formula of 6-methyl-2,5-dihydro-1H-pyrrolo[3,4-c]pyridine-3,4-dione,sulfuric acid is C16H18N4O8S. |