6-methyl-7-nitro-1,5-dihydrofuro[3,4-c]pyridine-3,4-dione structure
|
Common Name | 6-methyl-7-nitro-1,5-dihydrofuro[3,4-c]pyridine-3,4-dione | ||
|---|---|---|---|---|
| CAS Number | 89159-37-5 | Molecular Weight | 210.14400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H6N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 6-methyl-7-nitro-1,5-dihydrofuro[3,4-c]pyridine-3,4-dione |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H6N2O5 |
|---|---|
| Molecular Weight | 210.14400 |
| Exact Mass | 210.02800 |
| PSA | 105.24000 |
| LogP | 1.19740 |
| InChIKey | LAKPWIPRNZPABO-UHFFFAOYSA-N |
| SMILES | Cc1[nH]c(=O)c2c(c1[N+](=O)[O-])COC2=O |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 4 | |
|---|---|
| DownStream 1 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 6-Methyl-7-nitro-1H,5H-furo[3,4-c]pyridin-3,4-dion |
| 6-methyl-7-nitro-1H,5H-furo[3,4-c]pyridine-3,4-dione |
| 6-Methyl-7-nitro-1H-furano<3,4-c>pyridine-3,4(5H)-dione |
| LAKPWIPRNZPABO-UHFFFAOYSA |
| Furo[3,4-c]pyridine-3,4(1H,5H)-dione,6-methyl-7-nitro |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 6-methyl-7-nitro-1,5-dihydrofuro[3,4-c]pyridine-3,4-dione? |
| A: InChIKey of 6-methyl-7-nitro-1,5-dihydrofuro[3,4-c]pyridine-3,4-dione is LAKPWIPRNZPABO-UHFFFAOYSA-N. |
| Q: What is the English name of 6-methyl-7-nitro-1,5-dihydrofuro[3,4-c]pyridine-3,4-dione? |
| A: The English name of 6-methyl-7-nitro-1,5-dihydrofuro[3,4-c]pyridine-3,4-dione is 6-methyl-7-nitro-1,5-dihydrofuro[3,4-c]pyridine-3,4-dione. |
| Q: What English synonyms does 6-methyl-7-nitro-1,5-dihydrofuro[3,4-c]pyridine-3,4-dione have? |
| A: English synonyms of 6-methyl-7-nitro-1,5-dihydrofuro[3,4-c]pyridine-3,4-dione: 6-Methyl-7-nitro-1H,5H-furo[3,4-c]pyridin-3,4-dion, 6-methyl-7-nitro-1H,5H-furo[3,4-c]pyridine-3,4-dione, 6-Methyl-7-nitro-1H-furanopyridine-3,4(5H)-dione, LAKPWIPRNZPABO-UHFFFAOYSA, Furo[3,4-c]pyridine-3,4(1H,5H)-dione,6-methyl-7-nitro. |
| Q: What is the LogP of 6-methyl-7-nitro-1,5-dihydrofuro[3,4-c]pyridine-3,4-dione? |
| A: LogP of 6-methyl-7-nitro-1,5-dihydrofuro[3,4-c]pyridine-3,4-dione is 1.19740. |
| Q: What is the CAS number of 6-methyl-7-nitro-1,5-dihydrofuro[3,4-c]pyridine-3,4-dione? |
| A: CAS number of 6-methyl-7-nitro-1,5-dihydrofuro[3,4-c]pyridine-3,4-dione is 89159-37-5. |
| Q: What are the upstream materials of 6-methyl-7-nitro-1,5-dihydrofuro[3,4-c]pyridine-3,4-dione? |
| A: Related upstream materials(CAS) of 6-methyl-7-nitro-1,5-dihydrofuro[3,4-c]pyridine-3,4-dione: 89159-32-0;7472-18-6;17718-67-1;6339-38-4. |
| Q: What is the SMILES notation of 6-methyl-7-nitro-1,5-dihydrofuro[3,4-c]pyridine-3,4-dione? |
| A: SMILES notation of 6-methyl-7-nitro-1,5-dihydrofuro[3,4-c]pyridine-3,4-dione is Cc1[nH]c(=O)c2c(c1[N+](=O)[O-])COC2=O. |
| Q: What is the molecular formula of 6-methyl-7-nitro-1,5-dihydrofuro[3,4-c]pyridine-3,4-dione? |
| A: Molecular formula of 6-methyl-7-nitro-1,5-dihydrofuro[3,4-c]pyridine-3,4-dione is C8H6N2O5. |
| Q: What are the downstream products of 6-methyl-7-nitro-1,5-dihydrofuro[3,4-c]pyridine-3,4-dione? |
| A: Related downstream products(CAS) of 6-methyl-7-nitro-1,5-dihydrofuro[3,4-c]pyridine-3,4-dione: 4543-56-0. |
| Q: What is the molecular weight of 6-methyl-7-nitro-1,5-dihydrofuro[3,4-c]pyridine-3,4-dione? |
| A: Molecular weight of 6-methyl-7-nitro-1,5-dihydrofuro[3,4-c]pyridine-3,4-dione is 210.14400. |