Stannane, triphenyl- structure
|
Common Name | Stannane, triphenyl- | ||
|---|---|---|---|---|
| CAS Number | 892-20-6 | Molecular Weight | 350.01300 | |
| Density | 1.374 g/mL at 25ºC(lit.) | Boiling Point | 163-165ºC0.3 mm Hg(lit.) | |
| Molecular Formula | C18H15Sn | Melting Point | 28ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | >230 °F | |
| Symbol |
GHS06, GHS09 |
Signal Word | Danger | |
| Name | triphenylstannane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.374 g/mL at 25ºC(lit.) |
|---|---|
| Boiling Point | 163-165ºC0.3 mm Hg(lit.) |
| Melting Point | 28ºC(lit.) |
| Molecular Formula | C18H15Sn |
| Molecular Weight | 350.01300 |
| Flash Point | >230 °F |
| Exact Mass | 351.02000 |
| LogP | 2.20280 |
| Index of Refraction | n20/D 1.632(lit.) |
| InChIKey | SBXWFLISHPUINY-UHFFFAOYSA-N |
| SMILES | c1ccc([Sn](c2ccccc2)c2ccccc2)cc1 |
| Storage condition | 0-6°C |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS06, GHS09 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H301 + H311 + H331-H410 |
| Precautionary Statements | P261-P273-P280-P301 + P310 + P330-P302 + P352 + P312-P304 + P340 + P312 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Faceshields;Gloves;type P2 (EN 143) respirator cartridges |
| Hazard Codes | T: Toxic;N: Dangerous for the environment; |
| Risk Phrases | R23/24/25 |
| Safety Phrases | S26;S27;S28;S45;S60;S61 |
| RIDADR | UN 3077 9/PG 3 |
| WGK Germany | 3 |
| RTECS | WH8882000 |
| Packaging Group | III |
| Hazard Class | 6.1 |
| HS Code | 2931900090 |
| Precursor 10 | |
|---|---|
| DownStream 9 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
|
Comparative toxicity of antifouling compounds on the development of sea urchin.
Ecotoxicology 20(8) , 1870-80, (2011) In the present study, embryotoxicity experiments using the sea urchin Lytechinus variegatus were carried out to better clarify the ecotoxicological effects of tributyltin (TBT) and triphenyltin (TPT) ... |
|
|
Effects of organotin alternative antifoulants on oyster embryo.
Arch. Environ. Contam. Toxicol. 61(1) , 128-34, (2011) In September 2008, organotin (Ot) compounds were prohibited from being used worldwide. From 1997 onward in Japan, the production of paints containing TBT (tributylin) compounds was prohibited, and thu... |
|
|
Triphenyltin induced growth inhibition and antioxidative responses in the green microalga Scenedesmus quadricauda.
Ecotoxicology 20(1) , 73-80, (2011) The toxicity of organotin compounds in the environment is closely related to their uptake by microorganisms and delivery through the food chain. The population at low trophic levels like microalgae pl... |
| TRIPHENYLTIN HYDRIDE |
| FLUOROTRIPHENYLTIN |
| biomet204 |
| Triphenylfluorstannan |
| Triphenylzinnfluorid |
| fluorotriphenyl-ti |
| TRIPHENYLFLUOROTIN |
| Fluorotriphenyltin(IV) |
| triphenyl tin fluoride |
| EINECS 212-967-8 |
| fluorotriphenyl-stannan |
| fentin fluoride |
| MFCD00003004 |