4-(difluoromethylidene)-5,5-diphenyl-3H-pyrazole
4-(difluoromethylidene)-5,5-diphenyl-3H-pyrazole structure
|
Common Name | 4-(difluoromethylidene)-5,5-diphenyl-3H-pyrazole | ||
|---|---|---|---|---|
| CAS Number | 89210-57-1 | Molecular Weight | 270.27700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H12F2N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-(difluoromethylidene)-5,5-diphenyl-3H-pyrazole |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H12F2N2 |
|---|---|
| Molecular Weight | 270.27700 |
| Exact Mass | 270.09700 |
| PSA | 24.72000 |
| LogP | 3.41780 |
| InChIKey | UWJDNPXORAODCD-UHFFFAOYSA-N |
| SMILES | FC(F)=C1CN=NC1(c1ccccc1)c1ccccc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
4-(difluorometh... CAS#:89210-57-1 |
| Literature: Dolbier, William R.; Burkholder, Conrad R.; Winchester, William R. Journal of Organic Chemistry, 1984 , vol. 49, # 9 p. 1518 - 1522 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 3H-Pyrazole,4-(difluoromethylene)-4,5-dihydro-3,3-diphenyl |
| 4-(difluoromethylene)-4,5-dihydro-3,3-diphenyl-3H-pyrazole |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 4-(difluoromethylidene)-5,5-diphenyl-3H-pyrazole? |
| A: Molecular weight of 4-(difluoromethylidene)-5,5-diphenyl-3H-pyrazole is 270.27700. |
| Q: What is the LogP of 4-(difluoromethylidene)-5,5-diphenyl-3H-pyrazole? |
| A: LogP of 4-(difluoromethylidene)-5,5-diphenyl-3H-pyrazole is 3.41780. |
| Q: What is the CAS number of 4-(difluoromethylidene)-5,5-diphenyl-3H-pyrazole? |
| A: CAS number of 4-(difluoromethylidene)-5,5-diphenyl-3H-pyrazole is 89210-57-1. |
| Q: What is the polar surface area (PSA) of 4-(difluoromethylidene)-5,5-diphenyl-3H-pyrazole? |
| A: Polar surface area (PSA) of 4-(difluoromethylidene)-5,5-diphenyl-3H-pyrazole is 24.72000. |
| Q: What is the Chinese name of 89210-57-1? |
| A: Chinese name of 89210-57-1 is 89210-57-1. |
| Q: What is the molecular formula of 4-(difluoromethylidene)-5,5-diphenyl-3H-pyrazole? |
| A: Molecular formula of 4-(difluoromethylidene)-5,5-diphenyl-3H-pyrazole is C16H12F2N2. |
| Q: What is the SMILES notation of 4-(difluoromethylidene)-5,5-diphenyl-3H-pyrazole? |
| A: SMILES notation of 4-(difluoromethylidene)-5,5-diphenyl-3H-pyrazole is FC(F)=C1CN=NC1(c1ccccc1)c1ccccc1. |
| Q: What is the English name of 4-(difluoromethylidene)-5,5-diphenyl-3H-pyrazole? |
| A: The English name of 4-(difluoromethylidene)-5,5-diphenyl-3H-pyrazole is 4-(difluoromethylidene)-5,5-diphenyl-3H-pyrazole. |
| Q: What are the upstream materials of 4-(difluoromethylidene)-5,5-diphenyl-3H-pyrazole? |
| A: Related upstream materials(CAS) of 4-(difluoromethylidene)-5,5-diphenyl-3H-pyrazole: 430-64-8. |
| Q: What English synonyms does 4-(difluoromethylidene)-5,5-diphenyl-3H-pyrazole have? |
| A: English synonyms of 4-(difluoromethylidene)-5,5-diphenyl-3H-pyrazole: 3H-Pyrazole,4-(difluoromethylene)-4,5-dihydro-3,3-diphenyl, 4-(difluoromethylene)-4,5-dihydro-3,3-diphenyl-3H-pyrazole. |