5-(difluoromethylidene)-3,3-diphenyl-4H-pyrazole
5-(difluoromethylidene)-3,3-diphenyl-4H-pyrazole structure
|
Common Name | 5-(difluoromethylidene)-3,3-diphenyl-4H-pyrazole | ||
|---|---|---|---|---|
| CAS Number | 89210-58-2 | Molecular Weight | 270.27700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H12F2N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-(difluoromethylidene)-3,3-diphenyl-4H-pyrazole |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H12F2N2 |
|---|---|
| Molecular Weight | 270.27700 |
| Exact Mass | 270.09700 |
| PSA | 24.72000 |
| LogP | 3.76540 |
| InChIKey | WQGMLPYQJDKKII-UHFFFAOYSA-N |
| SMILES | FC(F)=C1CC(c2ccccc2)(c2ccccc2)N=N1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
5-(difluorometh... CAS#:89210-58-2
Learn More
|
| Literature: Dolbier, William R.; Burkholder, Conrad R.; Winchester, William R. Journal of Organic Chemistry, 1984 , vol. 49, # 9 p. 1518 - 1522 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 3H-Pyrazole,5-(difluoromethylene)-4,5-dihydro-3,3-diphenyl |
| 5-(difluoromethylene)-4,5-dihydro-3,3-diphenyl-3H-pyrazole |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What English synonyms does 5-(difluoromethylidene)-3,3-diphenyl-4H-pyrazole have? |
| A: English synonyms of 5-(difluoromethylidene)-3,3-diphenyl-4H-pyrazole: 3H-Pyrazole,5-(difluoromethylene)-4,5-dihydro-3,3-diphenyl, 5-(difluoromethylene)-4,5-dihydro-3,3-diphenyl-3H-pyrazole. |
| Q: What are the upstream materials of 5-(difluoromethylidene)-3,3-diphenyl-4H-pyrazole? |
| A: Related upstream materials(CAS) of 5-(difluoromethylidene)-3,3-diphenyl-4H-pyrazole: 430-64-8. |
| Q: What is the molecular weight of 5-(difluoromethylidene)-3,3-diphenyl-4H-pyrazole? |
| A: Molecular weight of 5-(difluoromethylidene)-3,3-diphenyl-4H-pyrazole is 270.27700. |
| Q: What is the polar surface area (PSA) of 5-(difluoromethylidene)-3,3-diphenyl-4H-pyrazole? |
| A: Polar surface area (PSA) of 5-(difluoromethylidene)-3,3-diphenyl-4H-pyrazole is 24.72000. |
| Q: What is the CAS number of 5-(difluoromethylidene)-3,3-diphenyl-4H-pyrazole? |
| A: CAS number of 5-(difluoromethylidene)-3,3-diphenyl-4H-pyrazole is 89210-58-2. |
| Q: What is the English name of 5-(difluoromethylidene)-3,3-diphenyl-4H-pyrazole? |
| A: The English name of 5-(difluoromethylidene)-3,3-diphenyl-4H-pyrazole is 5-(difluoromethylidene)-3,3-diphenyl-4H-pyrazole. |
| Q: What is the LogP of 5-(difluoromethylidene)-3,3-diphenyl-4H-pyrazole? |
| A: LogP of 5-(difluoromethylidene)-3,3-diphenyl-4H-pyrazole is 3.76540. |
| Q: What is the molecular formula of 5-(difluoromethylidene)-3,3-diphenyl-4H-pyrazole? |
| A: Molecular formula of 5-(difluoromethylidene)-3,3-diphenyl-4H-pyrazole is C16H12F2N2. |
| Q: What is the Chinese name of 89210-58-2? |
| A: Chinese name of 89210-58-2 is 89210-58-2. |
| Q: What is the InChIKey of 5-(difluoromethylidene)-3,3-diphenyl-4H-pyrazole? |
| A: InChIKey of 5-(difluoromethylidene)-3,3-diphenyl-4H-pyrazole is WQGMLPYQJDKKII-UHFFFAOYSA-N. |