GSK-269984B structure
|
Common Name | GSK-269984B | ||
|---|---|---|---|---|
| CAS Number | 892664-17-4 | Molecular Weight | 406.23400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H14Cl2FNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of GSK-269984BGSK-269984B is a potent EP1 antagonist. GSK-269984B has the potential for inflammatory pain research[1]. |
| Name | 6-[[5-chloro-2-[(4-chloro-2-fluorophenyl)methoxy]phenyl]methyl]pyridine-2-carboxylic acid |
|---|
| Description | GSK-269984B is a potent EP1 antagonist. GSK-269984B has the potential for inflammatory pain research[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C20H14Cl2FNO3 |
|---|---|
| Molecular Weight | 406.23400 |
| Exact Mass | 405.03300 |
| PSA | 59.42000 |
| LogP | 5.39550 |
| InChIKey | HJPAXYLYYQIFCK-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cccc(Cc2cc(Cl)ccc2OCc2ccc(Cl)cc2F)n1 |