Dehydronitrendipine structure
|
Common Name | Dehydronitrendipine | ||
|---|---|---|---|---|
| CAS Number | 89267-41-4 | Molecular Weight | 358.345 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 465.4±45.0 °C at 760 mmHg | |
| Molecular Formula | C18H18N2O6 | Melting Point | 59-61℃ | |
| MSDS | N/A | Flash Point | 235.3±28.7 °C | |
| Name | 3-O-ethyl 5-O-methyl 2,6-dimethyl-4-(3-nitrophenyl)pyridine-3,5-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 465.4±45.0 °C at 760 mmHg |
| Melting Point | 59-61℃ |
| Molecular Formula | C18H18N2O6 |
| Molecular Weight | 358.345 |
| Flash Point | 235.3±28.7 °C |
| Exact Mass | 358.116486 |
| PSA | 111.31000 |
| LogP | 3.56 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.569 |
| InChIKey | YEHVABIPGJLMET-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1c(C)nc(C)c(C(=O)OC)c1-c1cccc([N+](=O)[O-])c1 |
|
~99%
Dehydronitrendipine CAS#:89267-41-4 |
| Literature: Pfister Synthesis, 1990 , # 8 p. 689 - 690 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
|
Pharmacokinetics of nitrendipine in patients with renal failure: comparison to normal subjects.
J. Cardiovasc. Pharmacol. 6 Suppl 7 , S974-6, (1984) To determine the effect of decreased renal function on the elimination kinetics of the calcium entry blocker nitrendipine and its metabolite, we gave 18 subjects with various levels of renal dysfuncti... |
| Nitrendipine M (dehydro) |
| Ethyl methyl 2,6-dimethyl-4-(3-nitrophenyl)pyridine-3,5-dicarboxylate |
| 2,6-dimethyl-3-methoxycarbonyl-4-(m-nitrophenyl)-5-ethoxycarbonylpyridine |
| 3,5-Pyridinedicarboxylic acid, 2,6-dimethyl-4-(3-nitrophenyl)-, ethyl methyl ester |
| (+/-)-Oxidized Nitrendipine |
| Bay-m 4786 |
| 2,6-Dimethyl-4-(3-nitro-phenyl)-pyridine-3,5-dicarboxylic acid 3-ethyl; ester 5-methyl ester |
| 2,6-dimethyl-4-(3-nitrophenyl)-3,5-pyridinedicarboxylic acid ethyl methyl ester |
| Ethyl methyl 2,6-dimethyl-4-(3-nitrophenyl)-3,5-pyridinedicarboxylate |
| 3-ethyl 5-methyl 4-(3-nitrophenyl)-2,6-dimethyl-3,5-pyridinedicarboxylate |
| 3,5-Pyridinedicarboxylic acid,2,6-dimethyl-4-(3-nitrophenyl)-,ethyl methyl ester |
| ethylmethyl-2,6-dimethyl-4-(3-nitrophenyl)-3,5-pyridinedicarboxylate |