2-sulfanylidene-7,9-dihydro-3H-purin-8-one structure
|
Common Name | 2-sulfanylidene-7,9-dihydro-3H-purin-8-one | ||
|---|---|---|---|---|
| CAS Number | 89282-20-2 | Molecular Weight | 168.17600 | |
| Density | 2.08g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C5H4N4OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-sulfanylidene-7,9-dihydro-3H-purin-8-one |
|---|---|
| Synonym | More Synonyms |
| Density | 2.08g/cm3 |
|---|---|
| Molecular Formula | C5H4N4OS |
| Molecular Weight | 168.17600 |
| Exact Mass | 168.01100 |
| PSA | 109.42000 |
| LogP | 0.30880 |
| Index of Refraction | 2.019 |
| InChIKey | DXKLAQMZDYZMFM-UHFFFAOYSA-N |
| SMILES | O=c1[nH]c2cnc(=S)[nH]c2[nH]1 |
|
~%
2-sulfanylidene... CAS#:89282-20-2 |
| Literature: Noell; Robins Journal of Organic Chemistry, 1959 , vol. 24, p. 320,321 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-thioxo-1,2,7,9-tetrahydro-purin-8-one |