1-amino-4-ethylsulfanyl-10H-acridin-9-one
1-amino-4-ethylsulfanyl-10H-acridin-9-one structure
|
Common Name | 1-amino-4-ethylsulfanyl-10H-acridin-9-one | ||
|---|---|---|---|---|
| CAS Number | 89331-34-0 | Molecular Weight | 270.34900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H14N2OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-amino-4-ethylsulfanyl-10H-acridin-9-one |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H14N2OS |
|---|---|
| Molecular Weight | 270.34900 |
| Exact Mass | 270.08300 |
| PSA | 84.18000 |
| LogP | 3.95670 |
| InChIKey | JKDQZBGSIZMPOH-UHFFFAOYSA-N |
| SMILES | CCSc1ccc(N)c2c(=O)c3ccccc3[nH]c12 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~3%
1-amino-4-ethyl... CAS#:89331-34-0
Detail
Learn More
|
| Literature: Weltrowski, Marek; Ledochowski, Andrzej; Sowinski, Pawel Polish Journal of Chemistry, 1982 , vol. 56, # 1 p. 77 - 82 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 1 | |
CAS#:89331-36-2This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1-amino-4-ethylthio-9-acridone |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 89331-34-0? |
| A: Chinese name of 89331-34-0 is 89331-34-0. |
| Q: What is the molecular weight of 1-amino-4-ethylsulfanyl-10H-acridin-9-one? |
| A: Molecular weight of 1-amino-4-ethylsulfanyl-10H-acridin-9-one is 270.34900. |
| Q: What is the LogP of 1-amino-4-ethylsulfanyl-10H-acridin-9-one? |
| A: LogP of 1-amino-4-ethylsulfanyl-10H-acridin-9-one is 3.95670. |
| Q: What English synonyms does 1-amino-4-ethylsulfanyl-10H-acridin-9-one have? |
| A: English synonyms of 1-amino-4-ethylsulfanyl-10H-acridin-9-one: 1-amino-4-ethylthio-9-acridone. |
| Q: What is the polar surface area (PSA) of 1-amino-4-ethylsulfanyl-10H-acridin-9-one? |
| A: Polar surface area (PSA) of 1-amino-4-ethylsulfanyl-10H-acridin-9-one is 84.18000. |
| Q: What is the InChIKey of 1-amino-4-ethylsulfanyl-10H-acridin-9-one? |
| A: InChIKey of 1-amino-4-ethylsulfanyl-10H-acridin-9-one is JKDQZBGSIZMPOH-UHFFFAOYSA-N. |
| Q: What is the English name of 1-amino-4-ethylsulfanyl-10H-acridin-9-one? |
| A: The English name of 1-amino-4-ethylsulfanyl-10H-acridin-9-one is 1-amino-4-ethylsulfanyl-10H-acridin-9-one. |
| Q: What is the molecular formula of 1-amino-4-ethylsulfanyl-10H-acridin-9-one? |
| A: Molecular formula of 1-amino-4-ethylsulfanyl-10H-acridin-9-one is C15H14N2OS. |
| Q: What is the CAS number of 1-amino-4-ethylsulfanyl-10H-acridin-9-one? |
| A: CAS number of 1-amino-4-ethylsulfanyl-10H-acridin-9-one is 89331-34-0. |
| Q: What is the SMILES notation of 1-amino-4-ethylsulfanyl-10H-acridin-9-one? |
| A: SMILES notation of 1-amino-4-ethylsulfanyl-10H-acridin-9-one is CCSc1ccc(N)c2c(=O)c3ccccc3[nH]c12. |