N-(4-ethylsulfanyl-9-oxo-10H-acridin-1-yl)acetamide
N-(4-ethylsulfanyl-9-oxo-10H-acridin-1-yl)acetamide structure
|
Common Name | N-(4-ethylsulfanyl-9-oxo-10H-acridin-1-yl)acetamide | ||
|---|---|---|---|---|
| CAS Number | 89331-36-2 | Molecular Weight | 312.38600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H16N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-(4-ethylsulfanyl-9-oxo-10H-acridin-1-yl)acetamide |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C17H16N2O2S |
|---|---|
| Molecular Weight | 312.38600 |
| Exact Mass | 312.09300 |
| PSA | 90.75000 |
| LogP | 4.40120 |
| InChIKey | FQVIWWIMJMAYHA-UHFFFAOYSA-N |
| SMILES | CCSc1ccc(NC(C)=O)c2c(=O)c3ccccc3[nH]c12 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~82%
N-(4-ethylsulfa... CAS#:89331-36-2 |
| Literature: Weltrowski, Marek; Ledochowski, Andrzej; Sowinski, Pawel Polish Journal of Chemistry, 1982 , vol. 56, # 1 p. 77 - 82 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1-acetylamino-4-ethylthio-9-acridone |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of N-(4-ethylsulfanyl-9-oxo-10H-acridin-1-yl)acetamide? |
| A: LogP of N-(4-ethylsulfanyl-9-oxo-10H-acridin-1-yl)acetamide is 4.40120. |
| Q: What is the molecular weight of N-(4-ethylsulfanyl-9-oxo-10H-acridin-1-yl)acetamide? |
| A: Molecular weight of N-(4-ethylsulfanyl-9-oxo-10H-acridin-1-yl)acetamide is 312.38600. |
| Q: What English synonyms does N-(4-ethylsulfanyl-9-oxo-10H-acridin-1-yl)acetamide have? |
| A: English synonyms of N-(4-ethylsulfanyl-9-oxo-10H-acridin-1-yl)acetamide: 1-acetylamino-4-ethylthio-9-acridone. |
| Q: What is the Chinese name of 89331-36-2? |
| A: Chinese name of 89331-36-2 is 89331-36-2. |
| Q: What is the SMILES notation of N-(4-ethylsulfanyl-9-oxo-10H-acridin-1-yl)acetamide? |
| A: SMILES notation of N-(4-ethylsulfanyl-9-oxo-10H-acridin-1-yl)acetamide is CCSc1ccc(NC(C)=O)c2c(=O)c3ccccc3[nH]c12. |
| Q: What is the InChIKey of N-(4-ethylsulfanyl-9-oxo-10H-acridin-1-yl)acetamide? |
| A: InChIKey of N-(4-ethylsulfanyl-9-oxo-10H-acridin-1-yl)acetamide is FQVIWWIMJMAYHA-UHFFFAOYSA-N. |
| Q: What is the polar surface area (PSA) of N-(4-ethylsulfanyl-9-oxo-10H-acridin-1-yl)acetamide? |
| A: Polar surface area (PSA) of N-(4-ethylsulfanyl-9-oxo-10H-acridin-1-yl)acetamide is 90.75000. |
| Q: What is the CAS number of N-(4-ethylsulfanyl-9-oxo-10H-acridin-1-yl)acetamide? |
| A: CAS number of N-(4-ethylsulfanyl-9-oxo-10H-acridin-1-yl)acetamide is 89331-36-2. |
| Q: What are the upstream materials of N-(4-ethylsulfanyl-9-oxo-10H-acridin-1-yl)acetamide? |
| A: Related upstream materials(CAS) of N-(4-ethylsulfanyl-9-oxo-10H-acridin-1-yl)acetamide: 89331-34-0;75-36-5. |
| Q: What is the English name of N-(4-ethylsulfanyl-9-oxo-10H-acridin-1-yl)acetamide? |
| A: The English name of N-(4-ethylsulfanyl-9-oxo-10H-acridin-1-yl)acetamide is N-(4-ethylsulfanyl-9-oxo-10H-acridin-1-yl)acetamide. |