1-amino-2,4-bis(ethylsulfanyl)-10H-acridin-9-one
1-amino-2,4-bis(ethylsulfanyl)-10H-acridin-9-one structure
|
Common Name | 1-amino-2,4-bis(ethylsulfanyl)-10H-acridin-9-one | ||
|---|---|---|---|---|
| CAS Number | 89331-35-1 | Molecular Weight | 330.46800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H18N2OS2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-amino-2,4-bis(ethylsulfanyl)-10H-acridin-9-one |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C17H18N2OS2 |
|---|---|
| Molecular Weight | 330.46800 |
| Exact Mass | 330.08600 |
| PSA | 109.48000 |
| LogP | 5.06870 |
| InChIKey | UVBJPCZNNZCMAO-UHFFFAOYSA-N |
| SMILES | CCSc1cc(SCC)c2[nH]c3ccccc3c(=O)c2c1N |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~17%
Detail
Learn More
|
| Literature: Weltrowski, Marek; Ledochowski, Andrzej; Sowinski, Pawel Polish Journal of Chemistry, 1982 , vol. 56, # 1 p. 77 - 82 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1-amino-2,4-diethylthio-9-acridone |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 1-amino-2,4-bis(ethylsulfanyl)-10H-acridin-9-one? |
| A: InChIKey of 1-amino-2,4-bis(ethylsulfanyl)-10H-acridin-9-one is UVBJPCZNNZCMAO-UHFFFAOYSA-N. |
| Q: What is the CAS number of 1-amino-2,4-bis(ethylsulfanyl)-10H-acridin-9-one? |
| A: CAS number of 1-amino-2,4-bis(ethylsulfanyl)-10H-acridin-9-one is 89331-35-1. |
| Q: What is the Chinese name of 89331-35-1? |
| A: Chinese name of 89331-35-1 is 89331-35-1. |
| Q: What is the molecular weight of 1-amino-2,4-bis(ethylsulfanyl)-10H-acridin-9-one? |
| A: Molecular weight of 1-amino-2,4-bis(ethylsulfanyl)-10H-acridin-9-one is 330.46800. |
| Q: What is the SMILES notation of 1-amino-2,4-bis(ethylsulfanyl)-10H-acridin-9-one? |
| A: SMILES notation of 1-amino-2,4-bis(ethylsulfanyl)-10H-acridin-9-one is CCSc1cc(SCC)c2[nH]c3ccccc3c(=O)c2c1N. |
| Q: What is the molecular formula of 1-amino-2,4-bis(ethylsulfanyl)-10H-acridin-9-one? |
| A: Molecular formula of 1-amino-2,4-bis(ethylsulfanyl)-10H-acridin-9-one is C17H18N2OS2. |
| Q: What English synonyms does 1-amino-2,4-bis(ethylsulfanyl)-10H-acridin-9-one have? |
| A: English synonyms of 1-amino-2,4-bis(ethylsulfanyl)-10H-acridin-9-one: 1-amino-2,4-diethylthio-9-acridone. |
| Q: What are the upstream materials of 1-amino-2,4-bis(ethylsulfanyl)-10H-acridin-9-one? |
| A: Related upstream materials(CAS) of 1-amino-2,4-bis(ethylsulfanyl)-10H-acridin-9-one: 4533-39-5;75-08-1. |
| Q: What is the English name of 1-amino-2,4-bis(ethylsulfanyl)-10H-acridin-9-one? |
| A: The English name of 1-amino-2,4-bis(ethylsulfanyl)-10H-acridin-9-one is 1-amino-2,4-bis(ethylsulfanyl)-10H-acridin-9-one. |
| Q: What is the LogP of 1-amino-2,4-bis(ethylsulfanyl)-10H-acridin-9-one? |
| A: LogP of 1-amino-2,4-bis(ethylsulfanyl)-10H-acridin-9-one is 5.06870. |