[5-(4-nitrophenyl)-1,3,4-thiadiazol-2-yl]thiourea structure
|
Common Name | [5-(4-nitrophenyl)-1,3,4-thiadiazol-2-yl]thiourea | ||
|---|---|---|---|---|
| CAS Number | 89335-10-4 | Molecular Weight | 281.31400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H7N5O2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [5-(4-nitrophenyl)-1,3,4-thiadiazol-2-yl]thiourea |
|---|
| Molecular Formula | C9H7N5O2S2 |
|---|---|
| Molecular Weight | 281.31400 |
| Exact Mass | 281.00400 |
| PSA | 177.75000 |
| LogP | 2.43460 |
| InChIKey | QRTPUUJWUIQWGY-UHFFFAOYSA-N |
| SMILES | NC(=S)Nc1nnc(-c2ccc([N+](=O)[O-])cc2)s1 |
|
~%
[5-(4-nitrophen... CAS#:89335-10-4 |
| Literature: Naik; Meher; Nayak Journal of the Indian Chemical Society, 1983 , vol. 60, # 7 p. 674 - 678 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |