1,3,4-Thiadiazol-2-amine,5-(4-nitrophenyl) structure
|
Common Name | 1,3,4-Thiadiazol-2-amine,5-(4-nitrophenyl) | ||
|---|---|---|---|---|
| CAS Number | 833-63-6 | Molecular Weight | 222.22400 | |
| Density | 1.535g/cm3 | Boiling Point | 454.4ºC at 760 mmHg | |
| Molecular Formula | C8H6N4O2S | Melting Point | 257-261ºC(lit.) | |
| MSDS | N/A | Flash Point | 228.6ºC | |
| Name | 5-(4-nitrophenyl)-1,3,4-thiadiazol-2-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.535g/cm3 |
|---|---|
| Boiling Point | 454.4ºC at 760 mmHg |
| Melting Point | 257-261ºC(lit.) |
| Molecular Formula | C8H6N4O2S |
| Molecular Weight | 222.22400 |
| Flash Point | 228.6ºC |
| Exact Mass | 222.02100 |
| PSA | 125.86000 |
| LogP | 2.79990 |
| Index of Refraction | 1.703 |
| InChIKey | XAPNDVNSXWXPJS-UHFFFAOYSA-N |
| SMILES | Nc1nnc(-c2ccc([N+](=O)[O-])cc2)s1 |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36 |
| HS Code | 2934999090 |
| Precursor 8 | |
|---|---|
| DownStream 4 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
Name: qHTS screening for TAG (triacylglycerol) accumulators in algae
Source: 11812
Target: N/A
External Id: FATTTLab-Algae-Lipid
|
|
Name: Small-molecule inhibitors of ST2 (IL1RL1)
Source: 20881
Target: interleukin-1 receptor-like 1 isoform [homo sapiens]
External Id: ST2_IL33_Inhibitors_Primary_Screening_77700
|
|
Name: Inhibition of alpha-glucosidase (unknown origin) using p-nitrophenyl-alpha-d-glucopyr...
Source: ChEMBL
Target: Maltase-glucoamylase
External Id: CHEMBL4305675
|
|
Name: Alphascreen assay for small molecules abrogating mHTT-CaM Interaction
Source: 24983
Target: Huntingtin
External Id: KUHTS-Muma KU-CaM-Htt INH-01
|
|
Name: Cell-based high throughput primary assay to identify activators of GPR151
Source: The Scripps Research Institute Molecular Screening Center
Target: RecName: Full=G-protein coupled receptor 151; AltName: Full=G-protein coupled receptor PGR7; AltName: Full=GPCR-2037; AltName: Full=Galanin receptor 4; AltName: Full=Galanin-receptor-like protein; Short=GalRL
External Id: GPR151_PHUNTER_AG_LUMI_1536_1X%ACT
|
|
Name: AlphaScreen-based biochemical high throughput primary assay to identify activators of...
Source: The Scripps Research Institute Molecular Screening Center
Target: N/A
External Id: FBW7_ACT_ALPHA_1536_1X%ACT PRUN
|
|
Name: AlphaScreen-based biochemical high throughput primary assay to identify inhibitors of...
Source: The Scripps Research Institute Molecular Screening Center
External Id: MITF_INH_Alpha_1536_1X%INH PRUN
|
| 2-amino-5-p-nitrophenyl-1,3,4-thiadiazole |
| 2-Amino-5-p-nitrofenil-1,3,4-tiadiazolo |
| L 1470 |
| MFCD00046073 |