Triisopropylsilylacetylene structure
|
Common Name | Triisopropylsilylacetylene | ||
|---|---|---|---|---|
| CAS Number | 89343-06-6 | Molecular Weight | 182.378 | |
| Density | 0.8±0.1 g/cm3 | Boiling Point | 230.7±0.0 °C at 760 mmHg | |
| Molecular Formula | C11H22Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 56.1±0.0 °C | |
| Name | Triisopropylsilylacetylene |
|---|---|
| Synonym | More Synonyms |
| Density | 0.8±0.1 g/cm3 |
|---|---|
| Boiling Point | 230.7±0.0 °C at 760 mmHg |
| Molecular Formula | C11H22Si |
| Molecular Weight | 182.378 |
| Flash Point | 56.1±0.0 °C |
| Exact Mass | 182.149078 |
| LogP | 4.79 |
| Vapour Pressure | 0.1±0.4 mmHg at 25°C |
| Index of Refraction | 1.429 |
| InChIKey | KZGWPHUWNWRTEP-UHFFFAOYSA-N |
| SMILES | C#C[Si](C(C)C)(C(C)C)C(C)C |
| Hazard Codes | Xi:Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36/37/39 |
| RIDADR | UN 1993 3/PG 3 |
| WGK Germany | 3 |
| Packaging Group | III |
| Hazard Class | 3.2 |
| HS Code | 2931900090 |
|
~84%
Triisopropylsil... CAS#:89343-06-6 |
| Literature: Anthony; Diederich Tetrahedron Letters, 1991 , vol. 32, # 31 p. 3787 - 3790 |
|
~%
Triisopropylsil... CAS#:89343-06-6 |
| Literature: Journal of Organic Chemistry, , vol. 67, # 19 p. 6841 - 6844 |
|
~%
Triisopropylsil... CAS#:89343-06-6 |
| Literature: Helvetica Chimica Acta, , vol. 66, # 8 p. 2397 - 2411 |
| Precursor 3 | |
|---|---|
| DownStream 9 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| Silane, ethynyltris(1-methylethyl)- |
| Triisopropylsilylacetylene |
| MFCD00075452 |
| Ethynyl(triisopropyl)silane |
| triisopropylsilylethyne |
| (TRIISOPROPYLSILYL)ACETYLENE |
| ethynyl-tri(propan-2-yl)silane |
| Ethynyltriisopropylsilane |