(2,3,4,6-tetramethoxy-7-phenylmethoxyphenanthren-9-yl)methanol structure
|
Common Name | (2,3,4,6-tetramethoxy-7-phenylmethoxyphenanthren-9-yl)methanol | ||
|---|---|---|---|---|
| CAS Number | 89356-74-1 | Molecular Weight | 434.48100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C26H26O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (2,3,4,6-tetramethoxy-7-phenylmethoxyphenanthren-9-yl)methanol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C26H26O6 |
|---|---|
| Molecular Weight | 434.48100 |
| Exact Mass | 434.17300 |
| PSA | 66.38000 |
| LogP | 5.09870 |
| InChIKey | KMVJBHXFURQOCG-UHFFFAOYSA-N |
| SMILES | COc1cc2c(cc1OCc1ccccc1)c(CO)cc1cc(OC)c(OC)c(OC)c12 |
|
~97%
(2,3,4,6-tetram... CAS#:89356-74-1 |
| Literature: Battersby, Alan R.; McDonald, Edward; Stachulski, Andrew V. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1983 , # 12 p. 3053 - 3064 |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| 7-benzyloxy-9-hydroxymethyl-2,3,4,6-tetramethoxyphenanthrene |