3,5,6,7-tetramethoxy-10-methylphenanthren-2-ol structure
|
Common Name | 3,5,6,7-tetramethoxy-10-methylphenanthren-2-ol | ||
|---|---|---|---|---|
| CAS Number | 89356-75-2 | Molecular Weight | 328.35900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H20O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3,5,6,7-tetramethoxy-10-methylphenanthren-2-ol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C19H20O5 |
|---|---|
| Molecular Weight | 328.35900 |
| Exact Mass | 328.13100 |
| PSA | 57.15000 |
| LogP | 4.04140 |
| InChIKey | KOXIWXJBPLAYAW-UHFFFAOYSA-N |
| SMILES | COc1cc2c(cc1O)c(C)cc1cc(OC)c(OC)c(OC)c12 |
|
~99%
3,5,6,7-tetrame... CAS#:89356-75-2 |
| Literature: Battersby, Alan R.; McDonald, Edward; Stachulski, Andrew V. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1983 , # 12 p. 3053 - 3064 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| 7-hydroxy-2,3,4,6-tetramethoxy-9-methylphenanthrene |
| 2-Phenanthrenol,3,5,6,7-tetramethoxy-10-methyl |