2,3,4,6-tetramethoxy-9-methyl-7-phenylmethoxyphenanthrene structure
|
Common Name | 2,3,4,6-tetramethoxy-9-methyl-7-phenylmethoxyphenanthrene | ||
|---|---|---|---|---|
| CAS Number | 89356-76-3 | Molecular Weight | 418.48200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C26H26O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,3,4,6-tetramethoxy-9-methyl-7-phenylmethoxyphenanthrene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C26H26O5 |
|---|---|
| Molecular Weight | 418.48200 |
| Exact Mass | 418.17800 |
| PSA | 46.15000 |
| LogP | 5.91480 |
| InChIKey | VPWZBHXZCMYPIX-UHFFFAOYSA-N |
| SMILES | COc1cc2c(cc1OCc1ccccc1)c(C)cc1cc(OC)c(OC)c(OC)c12 |
|
~87%
2,3,4,6-tetrame... CAS#:89356-76-3 |
| Literature: Battersby, Alan R.; McDonald, Edward; Stachulski, Andrew V. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1983 , # 12 p. 3053 - 3064 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 7-benzyloxy-2,3,4,6-tetramethoxy-9-methylphenanthrene |