2-(4-fluorophenyl)imino-1,2-diphenylethanone structure
|
Common Name | 2-(4-fluorophenyl)imino-1,2-diphenylethanone | ||
|---|---|---|---|---|
| CAS Number | 89357-28-8 | Molecular Weight | 303.33000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H14FNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(4-fluorophenyl)imino-1,2-diphenylethanone |
|---|
| Molecular Formula | C20H14FNO |
|---|---|
| Molecular Weight | 303.33000 |
| Exact Mass | 303.10600 |
| PSA | 29.43000 |
| LogP | 4.82940 |
| InChIKey | HLSUHOPGPLLONL-UHFFFAOYSA-N |
| SMILES | O=C(C(=Nc1ccc(F)cc1)c1ccccc1)c1ccccc1 |
|
~60%
2-(4-fluorophen... CAS#:89357-28-8 |
| Literature: Alcaide, Benito; Lopez-Mardomingo, Carmen; Perez-Ossorio, Rafael; Plumet, Joaquin Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1983 , # 11 p. 1649 - 1654 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |