3-Amino-2-(3,5-dimethylphenylamino)benzoic acid structure
|
Common Name | 3-Amino-2-(3,5-dimethylphenylamino)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 893612-97-0 | Molecular Weight | 256.30000 | |
| Density | 1.263g/cm3 | Boiling Point | 429ºC at 760 mmHg | |
| Molecular Formula | C15H16N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 213.2ºC | |
| Name | 3-amino-2-(3,5-dimethylanilino)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.263g/cm3 |
|---|---|
| Boiling Point | 429ºC at 760 mmHg |
| Molecular Formula | C15H16N2O2 |
| Molecular Weight | 256.30000 |
| Flash Point | 213.2ºC |
| Exact Mass | 256.12100 |
| PSA | 75.35000 |
| LogP | 3.98160 |
| Index of Refraction | 1.677 |
| InChIKey | XMZDOYVKQBUTHQ-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)cc(Nc2c(N)cccc2C(=O)O)c1 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2922499990 |
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| gl-0689 |
| or1979 |