(3,5-diphenyl-1-pyridin-3-ylpyrrol-2-yl)-phenylmethanone structure
|
Common Name | (3,5-diphenyl-1-pyridin-3-ylpyrrol-2-yl)-phenylmethanone | ||
|---|---|---|---|---|
| CAS Number | 89374-14-1 | Molecular Weight | 400.47100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C28H20N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (3,5-diphenyl-1-pyridin-3-ylpyrrol-2-yl)-phenylmethanone |
|---|
| Molecular Formula | C28H20N2O |
|---|---|
| Molecular Weight | 400.47100 |
| Exact Mass | 400.15800 |
| PSA | 34.89000 |
| LogP | 6.43730 |
| InChIKey | QMQPNDZAAOTETE-UHFFFAOYSA-N |
| SMILES | O=C(c1ccccc1)c1c(-c2ccccc2)cc(-c2ccccc2)n1-c1cccnc1 |
|
~%
(3,5-diphenyl-1... CAS#:89374-14-1 |
| Literature: Nesvadba, Petr; Strop, Petr; Kuthan, Josef Collection of Czechoslovak Chemical Communications, 1983 , vol. 48, # 11 p. 3307 - 3314 |
|
~%
(3,5-diphenyl-1... CAS#:89374-14-1 |
| Literature: Nesvadba, Petr; Strop, Petr; Kuthan, Josef Collection of Czechoslovak Chemical Communications, 1983 , vol. 48, # 11 p. 3307 - 3314 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |