(2,4,6-trimethylphenyl) 2,2-diethylbutanoate structure
|
Common Name | (2,4,6-trimethylphenyl) 2,2-diethylbutanoate | ||
|---|---|---|---|---|
| CAS Number | 89397-97-7 | Molecular Weight | 262.38700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H26O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (2,4,6-trimethylphenyl) 2,2-diethylbutanoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H26O2 |
|---|---|
| Molecular Weight | 262.38700 |
| Exact Mass | 262.19300 |
| PSA | 26.30000 |
| LogP | 4.73360 |
| InChIKey | WOWCSPNDSKTXJI-UHFFFAOYSA-N |
| SMILES | CCC(CC)(CC)C(=O)Oc1c(C)cc(C)cc1C |
|
~84%
(2,4,6-trimethy... CAS#:89397-97-7 |
| Literature: Kim, Sunggak; Lee, Jae In Journal of Organic Chemistry, 1984 , vol. 49, # 10 p. 1712 - 1716 |
|
~72%
(2,4,6-trimethy... CAS#:89397-97-7 |
| Literature: Kim, Sunggak; Lee, Jae In Journal of Organic Chemistry, 1984 , vol. 49, # 10 p. 1712 - 1716 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Butanoic acid,2,2-diethyl-,2,4,6-trimethylphenyl ester |
| Mesityl 2,2-diethylbutyrate |
| mesityl 2,2-diethylbutanoate |