Propanamide,2,2-dimethyl-N-(2,4,6-trimethylphenyl)- structure
|
Common Name | Propanamide,2,2-dimethyl-N-(2,4,6-trimethylphenyl)- | ||
|---|---|---|---|---|
| CAS Number | 19699-10-6 | Molecular Weight | 219.32300 | |
| Density | 0.992g/cm3 | Boiling Point | 327.1ºC at 760mmHg | |
| Molecular Formula | C14H21NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 197.4ºC | |
| Name | 2,2-dimethyl-N-(2,4,6-trimethylphenyl)propanamide |
|---|---|
| Synonym | More Synonyms |
| Density | 0.992g/cm3 |
|---|---|
| Boiling Point | 327.1ºC at 760mmHg |
| Molecular Formula | C14H21NO |
| Molecular Weight | 219.32300 |
| Flash Point | 197.4ºC |
| Exact Mass | 219.16200 |
| PSA | 29.10000 |
| LogP | 3.66940 |
| Vapour Pressure | 0.000207mmHg at 25°C |
| Index of Refraction | 1.535 |
| InChIKey | VIZITWCQKFOVLG-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)c(NC(=O)C(C)(C)C)c(C)c1 |
|
~%
Propanamide,2,2... CAS#:19699-10-6 |
| Literature: Russell, Glen A.; Rajaratnam, Ragine; Chen, Ping Acta Chemica Scandinavica, 1998 , vol. 52, # 5 p. 528 - 532 |
|
~%
Propanamide,2,2... CAS#:19699-10-6 |
| Literature: Robson,E. et al. Journal of the Chemical Society [Section] C: Organic, 1968 , p. 1324 - 1328 |
| N1-mesityl-2,2-dimethylpropanamide |
| CCG-833 |
| HMS1444D07 |