Benzenepropanoic acid, .beta.-hydroxy-.beta.-phenyl-, ethyl ester structure
|
Common Name | Benzenepropanoic acid, .beta.-hydroxy-.beta.-phenyl-, ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 894-18-8 | Molecular Weight | 270.32300 | |
| Density | 1.142g/cm3 | Boiling Point | 429.4ºC at 760 mmHg | |
| Molecular Formula | C17H18O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 178.5ºC | |
| Name | ethyl 3-hydroxy-3,3-diphenylpropanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.142g/cm3 |
|---|---|
| Boiling Point | 429.4ºC at 760 mmHg |
| Molecular Formula | C17H18O3 |
| Molecular Weight | 270.32300 |
| Flash Point | 178.5ºC |
| Exact Mass | 270.12600 |
| PSA | 46.53000 |
| LogP | 2.87570 |
| Index of Refraction | 1.563 |
| InChIKey | CPOPSLBZVNIING-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC(O)(c1ccccc1)c1ccccc1 |
| HS Code | 2918199090 |
|---|
| Precursor 8 | |
|---|---|
| DownStream 9 | |
| HS Code | 2918199090 |
|---|---|
| Summary | 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| Ethyl 3,3-diphenyl-3-hydroxypropanoate |
| ethyl 3,3-diphenyl-3-hydroxypropionate |
| ethyl 3-hydroxy-3,3-diphenyl-propanoate |