6-bromo-8-methoxy-N,N,2-trimethylquinolin-4-amine
6-bromo-8-methoxy-N,N,2-trimethylquinolin-4-amine structure
|
Common Name | 6-bromo-8-methoxy-N,N,2-trimethylquinolin-4-amine | ||
|---|---|---|---|---|
| CAS Number | 89446-16-2 | Molecular Weight | 295.17500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H15BrN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 6-bromo-8-methoxy-N,N,2-trimethylquinolin-4-amine |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H15BrN2O |
|---|---|
| Molecular Weight | 295.17500 |
| Exact Mass | 294.03700 |
| PSA | 25.36000 |
| LogP | 3.38030 |
| InChIKey | CDINDHCGHBIYIN-UHFFFAOYSA-N |
| SMILES | COc1cc(Br)cc2c(N(C)C)cc(C)nc12 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 6 | |
|---|---|
| DownStream 2 | |
CAS#:89446-17-3
CAS#:121269-28-1This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Dissociation constant of compound at 25 degree C
Source: ChEMBL
Target: N/A
External Id: CHEMBL641474
|
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 6-Bromo-4-dimethylamino-8-methoxy-2-methylquinoline |
| 4-Quinolinamine,6-bromo-8-methoxy-N,N,2-trimethyl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the downstream products of 6-bromo-8-methoxy-N,N,2-trimethylquinolin-4-amine? |
| A: Related downstream products(CAS) of 6-bromo-8-methoxy-N,N,2-trimethylquinolin-4-amine: 89446-17-3;121269-28-1. |
| Q: What is the polar surface area (PSA) of 6-bromo-8-methoxy-N,N,2-trimethylquinolin-4-amine? |
| A: Polar surface area (PSA) of 6-bromo-8-methoxy-N,N,2-trimethylquinolin-4-amine is 25.36000. |
| Q: What is the molecular formula of 6-bromo-8-methoxy-N,N,2-trimethylquinolin-4-amine? |
| A: Molecular formula of 6-bromo-8-methoxy-N,N,2-trimethylquinolin-4-amine is C13H15BrN2O. |
| Q: What is the InChIKey of 6-bromo-8-methoxy-N,N,2-trimethylquinolin-4-amine? |
| A: InChIKey of 6-bromo-8-methoxy-N,N,2-trimethylquinolin-4-amine is CDINDHCGHBIYIN-UHFFFAOYSA-N. |
| Q: What is the LogP of 6-bromo-8-methoxy-N,N,2-trimethylquinolin-4-amine? |
| A: LogP of 6-bromo-8-methoxy-N,N,2-trimethylquinolin-4-amine is 3.38030. |
| Q: What English synonyms does 6-bromo-8-methoxy-N,N,2-trimethylquinolin-4-amine have? |
| A: English synonyms of 6-bromo-8-methoxy-N,N,2-trimethylquinolin-4-amine: 6-Bromo-4-dimethylamino-8-methoxy-2-methylquinoline, 4-Quinolinamine,6-bromo-8-methoxy-N,N,2-trimethyl. |
| Q: What is the Chinese name of 89446-16-2? |
| A: Chinese name of 89446-16-2 is 89446-16-2. |
| Q: What is the English name of 6-bromo-8-methoxy-N,N,2-trimethylquinolin-4-amine? |
| A: The English name of 6-bromo-8-methoxy-N,N,2-trimethylquinolin-4-amine is 6-bromo-8-methoxy-N,N,2-trimethylquinolin-4-amine. |
| Q: What is the molecular weight of 6-bromo-8-methoxy-N,N,2-trimethylquinolin-4-amine? |
| A: Molecular weight of 6-bromo-8-methoxy-N,N,2-trimethylquinolin-4-amine is 295.17500. |
| Q: What is the SMILES notation of 6-bromo-8-methoxy-N,N,2-trimethylquinolin-4-amine? |
| A: SMILES notation of 6-bromo-8-methoxy-N,N,2-trimethylquinolin-4-amine is COc1cc(Br)cc2c(N(C)C)cc(C)nc12. |