4-(dimethylamino)-8-methoxy-2-methylquinoline-6-carbaldehyde
4-(dimethylamino)-8-methoxy-2-methylquinoline-6-carbaldehyde structure
|
Common Name | 4-(dimethylamino)-8-methoxy-2-methylquinoline-6-carbaldehyde | ||
|---|---|---|---|---|
| CAS Number | 89446-17-3 | Molecular Weight | 244.28900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H16N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-(dimethylamino)-8-methoxy-2-methylquinoline-6-carbaldehyde |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H16N2O2 |
|---|---|
| Molecular Weight | 244.28900 |
| Exact Mass | 244.12100 |
| PSA | 42.43000 |
| LogP | 2.43030 |
| InChIKey | VZTSVYQGSWRLHZ-UHFFFAOYSA-N |
| SMILES | COc1cc(C=O)cc2c(N(C)C)cc(C)nc12 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 8 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 4-Dimethylamino-6-formyl-8-methoxy-2-methylquinoline |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 4-(dimethylamino)-8-methoxy-2-methylquinoline-6-carbaldehyde? |
| A: Molecular weight of 4-(dimethylamino)-8-methoxy-2-methylquinoline-6-carbaldehyde is 244.28900. |
| Q: What English synonyms does 4-(dimethylamino)-8-methoxy-2-methylquinoline-6-carbaldehyde have? |
| A: English synonyms of 4-(dimethylamino)-8-methoxy-2-methylquinoline-6-carbaldehyde: 4-Dimethylamino-6-formyl-8-methoxy-2-methylquinoline. |
| Q: What are the upstream materials of 4-(dimethylamino)-8-methoxy-2-methylquinoline-6-carbaldehyde? |
| A: Related upstream materials(CAS) of 4-(dimethylamino)-8-methoxy-2-methylquinoline-6-carbaldehyde: 59557-91-4;90-04-0;89446-12-8;121269-26-9;89446-10-6;68-12-2;89446-16-2;109-72-8. |
| Q: What is the polar surface area (PSA) of 4-(dimethylamino)-8-methoxy-2-methylquinoline-6-carbaldehyde? |
| A: Polar surface area (PSA) of 4-(dimethylamino)-8-methoxy-2-methylquinoline-6-carbaldehyde is 42.43000. |
| Q: What is the molecular formula of 4-(dimethylamino)-8-methoxy-2-methylquinoline-6-carbaldehyde? |
| A: Molecular formula of 4-(dimethylamino)-8-methoxy-2-methylquinoline-6-carbaldehyde is C14H16N2O2. |
| Q: What is the Chinese name of 89446-17-3? |
| A: Chinese name of 89446-17-3 is 89446-17-3. |
| Q: What is the CAS number of 4-(dimethylamino)-8-methoxy-2-methylquinoline-6-carbaldehyde? |
| A: CAS number of 4-(dimethylamino)-8-methoxy-2-methylquinoline-6-carbaldehyde is 89446-17-3. |
| Q: What is the English name of 4-(dimethylamino)-8-methoxy-2-methylquinoline-6-carbaldehyde? |
| A: The English name of 4-(dimethylamino)-8-methoxy-2-methylquinoline-6-carbaldehyde is 4-(dimethylamino)-8-methoxy-2-methylquinoline-6-carbaldehyde. |
| Q: What is the SMILES notation of 4-(dimethylamino)-8-methoxy-2-methylquinoline-6-carbaldehyde? |
| A: SMILES notation of 4-(dimethylamino)-8-methoxy-2-methylquinoline-6-carbaldehyde is COc1cc(C=O)cc2c(N(C)C)cc(C)nc12. |
| Q: What is the InChIKey of 4-(dimethylamino)-8-methoxy-2-methylquinoline-6-carbaldehyde? |
| A: InChIKey of 4-(dimethylamino)-8-methoxy-2-methylquinoline-6-carbaldehyde is VZTSVYQGSWRLHZ-UHFFFAOYSA-N. |