4-Bromo-7-trifluoromethyl-quinoline structure
|
Common Name | 4-Bromo-7-trifluoromethyl-quinoline | ||
|---|---|---|---|---|
| CAS Number | 89446-67-3 | Molecular Weight | 276.053 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | 301.3±37.0 °C at 760 mmHg | |
| Molecular Formula | C10H5BrF3N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 136.0±26.5 °C | |
| Name | 4-Bromo-7-(trifluoromethyl)quinoline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Boiling Point | 301.3±37.0 °C at 760 mmHg |
| Molecular Formula | C10H5BrF3N |
| Molecular Weight | 276.053 |
| Flash Point | 136.0±26.5 °C |
| Exact Mass | 274.955750 |
| PSA | 12.89000 |
| LogP | 3.69 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.573 |
| InChIKey | GVRZSGYZKGTTDG-UHFFFAOYSA-N |
| SMILES | FC(F)(F)c1ccc2c(Br)ccnc2c1 |
| Hazard Codes | Xn |
|---|
|
~%
4-Bromo-7-trifl... CAS#:89446-67-3 |
| Literature: Barlin, Gordon B.; Ireland, Stephen J.; Jiravinyu, Chuenjit; Nguyen, Trang M. T.; Kotecka, Barbara; Rieckmann, Karl H. Australian Journal of Chemistry, 1993 , vol. 46, # 11 p. 1695 - 1704 |
| 4-Bromo-7-trifluoromethylquinoline |
| 4-Bromo-7-(trifluoromethyl)quinoline |
| 4-Bromo-7-trifluoromethyl-quinoline |