4-Bromo-7-trifluoromethyl-quinoline
4-Bromo-7-trifluoromethyl-quinoline structure
|
Common Name | 4-Bromo-7-trifluoromethyl-quinoline | ||
|---|---|---|---|---|
| CAS Number | 89446-67-3 | Molecular Weight | 276.053 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | 301.3±37.0 °C at 760 mmHg | |
| Molecular Formula | C10H5BrF3N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 136.0±26.5 °C | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-Bromo-7-(trifluoromethyl)quinoline |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Boiling Point | 301.3±37.0 °C at 760 mmHg |
| Molecular Formula | C10H5BrF3N |
| Molecular Weight | 276.053 |
| Flash Point | 136.0±26.5 °C |
| Exact Mass | 274.955750 |
| PSA | 12.89000 |
| LogP | 3.69 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.573 |
| InChIKey | GVRZSGYZKGTTDG-UHFFFAOYSA-N |
| SMILES | FC(F)(F)c1ccc2c(Br)ccnc2c1 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Hazard Codes | Xn |
|---|
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
4-Bromo-7-trifl... CAS#:89446-67-3 |
| Literature: Barlin, Gordon B.; Ireland, Stephen J.; Jiravinyu, Chuenjit; Nguyen, Trang M. T.; Kotecka, Barbara; Rieckmann, Karl H. Australian Journal of Chemistry, 1993 , vol. 46, # 11 p. 1695 - 1704 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 4-Bromo-7-trifluoromethylquinoline |
| 4-Bromo-7-(trifluoromethyl)quinoline |
| 4-Bromo-7-trifluoromethyl-quinoline |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 4-Bromo-7-(trifluoromethyl)quinoline? |
| A: InChIKey of 4-Bromo-7-(trifluoromethyl)quinoline is GVRZSGYZKGTTDG-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 4-Bromo-7-(trifluoromethyl)quinoline? |
| A: Molecular formula of 4-Bromo-7-(trifluoromethyl)quinoline is C10H5BrF3N. |
| Q: What is the CAS number of 4-Bromo-7-(trifluoromethyl)quinoline? |
| A: CAS number of 4-Bromo-7-(trifluoromethyl)quinoline is 89446-67-3. |
| Q: What is the SMILES notation of 4-Bromo-7-(trifluoromethyl)quinoline? |
| A: SMILES notation of 4-Bromo-7-(trifluoromethyl)quinoline is FC(F)(F)c1ccc2c(Br)ccnc2c1. |
| Q: What English synonyms does 4-Bromo-7-(trifluoromethyl)quinoline have? |
| A: English synonyms of 4-Bromo-7-(trifluoromethyl)quinoline: 4-Bromo-7-trifluoromethylquinoline, 4-Bromo-7-(trifluoromethyl)quinoline, 4-Bromo-7-trifluoromethyl-quinoline. |
| Q: What is the molecular weight of 4-Bromo-7-(trifluoromethyl)quinoline? |
| A: Molecular weight of 4-Bromo-7-(trifluoromethyl)quinoline is 276.053. |
| Q: What is the LogP of 4-Bromo-7-(trifluoromethyl)quinoline? |
| A: LogP of 4-Bromo-7-(trifluoromethyl)quinoline is 3.69. |
| Q: What is the boiling point of 4-Bromo-7-(trifluoromethyl)quinoline? |
| A: Boiling point of 4-Bromo-7-(trifluoromethyl)quinoline is 301.3±37.0 °C at 760 mmHg. |
| Q: What is the English name of 4-Bromo-7-(trifluoromethyl)quinoline? |
| A: The English name of 4-Bromo-7-(trifluoromethyl)quinoline is 4-Bromo-7-(trifluoromethyl)quinoline. |
| Q: What is the polar surface area (PSA) of 4-Bromo-7-(trifluoromethyl)quinoline? |
| A: Polar surface area (PSA) of 4-Bromo-7-(trifluoromethyl)quinoline is 12.89000. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |