4-(1,3-dioxoinden-2-yl)benzonitrile structure
|
Common Name | 4-(1,3-dioxoinden-2-yl)benzonitrile | ||
|---|---|---|---|---|
| CAS Number | 89447-90-5 | Molecular Weight | 247.24800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H9NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(1,3-dioxoinden-2-yl)benzonitrile |
|---|
| Molecular Formula | C16H9NO2 |
|---|---|
| Molecular Weight | 247.24800 |
| Exact Mass | 247.06300 |
| PSA | 57.93000 |
| LogP | 2.72108 |
| InChIKey | WSRUAEWHXYSQRO-UHFFFAOYSA-N |
| SMILES | N#Cc1ccc(C2C(=O)c3ccccc3C2=O)cc1 |
|
~30%
4-(1,3-dioxoind... CAS#:89447-90-5 |
| Literature: Harnack, Christian; Krull, Wolfgang; Lehnig, Manfred; Neumann, Wilhelm P.; Zarkadis, Antonios K. Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1994 , # 6 p. 1247 - 1252 |
|
~%
4-(1,3-dioxoind... CAS#:89447-90-5 |
| Literature: Cavallini et al. Farmaco, Edizione Scientifica, 1955 , vol. 10, p. 710,719 |