N-tert-butyl-4,6-diphenylpyridine-2-carboxamide structure
|
Common Name | N-tert-butyl-4,6-diphenylpyridine-2-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 89478-85-3 | Molecular Weight | 330.42300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H22N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-tert-butyl-4,6-diphenylpyridine-2-carboxamide |
|---|
| Molecular Formula | C22H22N2O |
|---|---|
| Molecular Weight | 330.42300 |
| Exact Mass | 330.17300 |
| PSA | 45.48000 |
| LogP | 5.51870 |
| InChIKey | FQOFEXLEHUVGCS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)NC(=O)c1cc(-c2ccccc2)cc(-c2ccccc2)n1 |
|
~70%
N-tert-butyl-4,... CAS#:89478-85-3 |
| Literature: Katritzky, Alan R.; Awartani, Radi Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1983 , # 11 p. 2623 - 2627 |
|
~71%
N-tert-butyl-4,... CAS#:89478-85-3 |
| Literature: Katritzky, Alan R.; Awartani, Radi Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1983 , # 11 p. 2623 - 2627 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |