2,2,2-trifluoro-N-(5-iodopyridin-2-yl)acetamide structure
|
Common Name | 2,2,2-trifluoro-N-(5-iodopyridin-2-yl)acetamide | ||
|---|---|---|---|---|
| CAS Number | 895057-26-8 | Molecular Weight | 316.01900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H4F3IN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,2,2-trifluoro-N-(5-iodopyridin-2-yl)acetamide |
|---|
| Molecular Formula | C7H4F3IN2O |
|---|---|
| Molecular Weight | 316.01900 |
| Exact Mass | 315.93200 |
| PSA | 45.48000 |
| LogP | 2.83650 |
| InChIKey | OUEPCSIMAAVCFK-UHFFFAOYSA-N |
| SMILES | O=C(Nc1ccc(I)cn1)C(F)(F)F |
|
~77%
2,2,2-trifluoro... CAS#:895057-26-8 |
| Literature: THE GOVERNMENT OF THE UNITED STATES, as represented by the secretary of HEALTH AND HUMAN SERVICES Patent: WO2007/124345 A2, 2007 ; Location in patent: Page/Page column 26 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |