acetic acid,4-but-2-enyl-3-ethylnaphthalene-1,2-diol structure
|
Common Name | acetic acid,4-but-2-enyl-3-ethylnaphthalene-1,2-diol | ||
|---|---|---|---|---|
| CAS Number | 89510-52-1 | Molecular Weight | 362.41700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H26O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | acetic acid,4-but-2-enyl-3-ethylnaphthalene-1,2-diol |
|---|
| Molecular Formula | C20H26O6 |
|---|---|
| Molecular Weight | 362.41700 |
| Exact Mass | 362.17300 |
| PSA | 115.06000 |
| LogP | 4.11380 |
| InChIKey | ATAQLOIZRHBQCL-UHFFFAOYSA-N |
| SMILES | CC(=O)O.CC(=O)O.CC=CCc1c(CC)c(O)c(O)c2ccccc12 |
|
~%
acetic acid,4-b... CAS#:89510-52-1 |
| Literature: Takuwa, Akio; Naruta, Yoshinori; Soga, Osamu; Maruyama, Kazuhiro Journal of Organic Chemistry, 1984 , vol. 49, # 11 p. 1857 - 1864 |
|
~%
acetic acid,4-b... CAS#:89510-52-1 |
| Literature: Takuwa, Akio; Naruta, Yoshinori; Soga, Osamu; Maruyama, Kazuhiro Journal of Organic Chemistry, 1984 , vol. 49, # 11 p. 1857 - 1864 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |