2-methyl-N-phenyl-5-propan-2-ylbenzenesulfonamide structure
|
Common Name | 2-methyl-N-phenyl-5-propan-2-ylbenzenesulfonamide | ||
|---|---|---|---|---|
| CAS Number | 89593-70-4 | Molecular Weight | 289.39300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H19NO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-methyl-N-phenyl-5-propan-2-ylbenzenesulfonamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H19NO2S |
|---|---|
| Molecular Weight | 289.39300 |
| Exact Mass | 289.11400 |
| PSA | 54.55000 |
| LogP | 5.07300 |
| InChIKey | OWIWJDMJPRXKMQ-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C(C)C)cc1S(=O)(=O)Nc1ccccc1 |
|
~%
2-methyl-N-phen... CAS#:89593-70-4 |
| Literature: Brown; Thomson Journal of the Chemical Society, 1950 , p. 1019 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 5-Isopropyl-2-methyl-benzolsulfonsaeure-anilid |
| 5-isopropyl-2-methyl-benzenesulfonic acid anilide |