N-Carbamoyl-L-tryptoph
Modify Date: 2025-08-24 20:56:37
N-Carbamoyl-L-tryptoph structure
|
Common Name | N-Carbamoyl-L-tryptoph | ||
|---|---|---|---|---|
| CAS Number | 89595-64-2 | Molecular Weight | 247.25000 | |
| Density | 1.435g/cm3 | Boiling Point | 538.393°C at 760 mmHg | |
| Molecular Formula | C12H13N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 279.41°C | |
| Name | N-Carbamoyl-L-tryptoph |
|---|---|
| Synonym | More Synonyms |
| Density | 1.435g/cm3 |
|---|---|
| Boiling Point | 538.393°C at 760 mmHg |
| Molecular Formula | C12H13N3O3 |
| Molecular Weight | 247.25000 |
| Flash Point | 279.41°C |
| Exact Mass | 247.09600 |
| PSA | 109.20000 |
| LogP | 1.73660 |
| InChIKey | NWLXJVDJMARXSP-JTQLQIEISA-N |
| SMILES | NC(=O)NC(Cc1c[nH]c2ccccc12)C(=O)O |
| WGK Germany | 3 |
|---|---|
| HS Code | 2933990090 |
|
~92%
N-Carbamoyl-L-t... CAS#:89595-64-2 |
| Literature: Verardo, Giancarlo; Geatti, Paola; Strazzolini, Paolo Synthetic Communications, 2007 , vol. 37, # 11 p. 1833 - 1844 |
|
~%
N-Carbamoyl-L-t... CAS#:89595-64-2 |
| Literature: Patching, Simon G. Journal of Labelled Compounds and Radiopharmaceuticals, 2011 , vol. 54, # 2 p. 110 - 114 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| N-Carbamoyl-S-leucine |
| N-Carbamoyl-L-leucin |
| N-carbamoylleucine |
| N-carbamoyl-L-leucine |
| N-carbamyl-L-tryptophan |
| 2-Isobutylhydantoic acid |
| N-carbamoyl-L-tryptophan |
| N-carbamyl-L-leucine |