ditert-butyl 3-hydroxy-3-methylpentanedioate
ditert-butyl 3-hydroxy-3-methylpentanedioate structure
|
Common Name | ditert-butyl 3-hydroxy-3-methylpentanedioate | ||
|---|---|---|---|---|
| CAS Number | 89622-82-2 | Molecular Weight | 274.35300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H26O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | ditert-butyl 3-hydroxy-3-methylpentanedioate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H26O5 |
|---|---|
| Molecular Weight | 274.35300 |
| Exact Mass | 274.17800 |
| PSA | 72.83000 |
| LogP | 2.20100 |
| InChIKey | FRKFWGBYXMXJOZ-UHFFFAOYSA-N |
| SMILES | CC(O)(CC(=O)OC(C)(C)C)CC(=O)OC(C)(C)C |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
ditert-butyl 3-... CAS#:89622-82-2 |
| Literature: Roussel Uclaf Patent: US4467108 A1, 1984 ; |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| ditert-butyl 3-methyl-3-hydroxy-glutarate |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of ditert-butyl 3-hydroxy-3-methylpentanedioate? |
| A: LogP of ditert-butyl 3-hydroxy-3-methylpentanedioate is 2.20100. |
| Q: What is the polar surface area (PSA) of ditert-butyl 3-hydroxy-3-methylpentanedioate? |
| A: Polar surface area (PSA) of ditert-butyl 3-hydroxy-3-methylpentanedioate is 72.83000. |
| Q: What is the CAS number of ditert-butyl 3-hydroxy-3-methylpentanedioate? |
| A: CAS number of ditert-butyl 3-hydroxy-3-methylpentanedioate is 89622-82-2. |
| Q: What is the molecular formula of ditert-butyl 3-hydroxy-3-methylpentanedioate? |
| A: Molecular formula of ditert-butyl 3-hydroxy-3-methylpentanedioate is C14H26O5. |
| Q: What is the SMILES notation of ditert-butyl 3-hydroxy-3-methylpentanedioate? |
| A: SMILES notation of ditert-butyl 3-hydroxy-3-methylpentanedioate is CC(O)(CC(=O)OC(C)(C)C)CC(=O)OC(C)(C)C. |
| Q: What is the molecular weight of ditert-butyl 3-hydroxy-3-methylpentanedioate? |
| A: Molecular weight of ditert-butyl 3-hydroxy-3-methylpentanedioate is 274.35300. |
| Q: What English synonyms does ditert-butyl 3-hydroxy-3-methylpentanedioate have? |
| A: English synonyms of ditert-butyl 3-hydroxy-3-methylpentanedioate: ditert-butyl 3-methyl-3-hydroxy-glutarate. |
| Q: What is the Chinese name of 89622-82-2? |
| A: Chinese name of 89622-82-2 is 89622-82-2. |
| Q: What is the InChIKey of ditert-butyl 3-hydroxy-3-methylpentanedioate? |
| A: InChIKey of ditert-butyl 3-hydroxy-3-methylpentanedioate is FRKFWGBYXMXJOZ-UHFFFAOYSA-N. |
| Q: What is the English name of ditert-butyl 3-hydroxy-3-methylpentanedioate? |
| A: The English name of ditert-butyl 3-hydroxy-3-methylpentanedioate is ditert-butyl 3-hydroxy-3-methylpentanedioate. |