tert-butyl n-(4-isothiocyanatophenyl)carbamate structure
|
Common Name | tert-butyl n-(4-isothiocyanatophenyl)carbamate | ||
|---|---|---|---|---|
| CAS Number | 89631-75-4 | Molecular Weight | 250.31700 | |
| Density | 1.12g/cm3 | Boiling Point | 329.2ºC at 760 mmHg | |
| Molecular Formula | C12H14N2O2S | Melting Point | 109-114ºC | |
| MSDS | Chinese USA | Flash Point | 152.9ºC | |
| Symbol |
GHS08 |
Signal Word | Danger | |
| Name | tert-butyl n-(4-isothiocyanatophenyl)carbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.12g/cm3 |
|---|---|
| Boiling Point | 329.2ºC at 760 mmHg |
| Melting Point | 109-114ºC |
| Molecular Formula | C12H14N2O2S |
| Molecular Weight | 250.31700 |
| Flash Point | 152.9ºC |
| Exact Mass | 250.07800 |
| PSA | 82.78000 |
| LogP | 3.84090 |
| Index of Refraction | 1.552 |
| InChIKey | KMOFDGFIFPIQCT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(N=C=S)cc1 |
| Symbol |
GHS08 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H317-H334 |
| Precautionary Statements | P261-P280-P342 + P311 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
| Hazard Codes | Xn: Harmful; |
| Risk Phrases | 42 |
| Safety Phrases | 22 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2930909090 |
|
~80%
tert-butyl n-(4... CAS#:89631-75-4 |
| Literature: YAMADA, Tesshi; SHITASHIGE, Miki; YOKOTA, Koichi; SAWA, Masaaki; MORIYAMA, Hideki Patent: US2010/137386 A1, 2010 ; Location in patent: Page/Page column 29 ; US 20100137386 A1 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2930909090 |
|---|---|
| Summary | 2930909090. other organo-sulphur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| MFCD01862957 |
| N-Boc-4-isothiocyanatoaniline |
| tert-butyl(4-isothiocyanatophenyl)carbamate |
| 4-[(1,1-dimethylethoxycarbonyl)amino]phenyl isothiocyanate |
| (4-isothiocyanato-phenyl)-carbamic acid tert-butyl ester |