N-(6-acetyl-2-cyano-3,4-dimethylphenyl)-2,2,2-trichloroacetamide structure
|
Common Name | N-(6-acetyl-2-cyano-3,4-dimethylphenyl)-2,2,2-trichloroacetamide | ||
|---|---|---|---|---|
| CAS Number | 89638-38-0 | Molecular Weight | 333.59800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H11Cl3N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(6-acetyl-2-cyano-3,4-dimethylphenyl)-2,2,2-trichloroacetamide |
|---|
| Molecular Formula | C13H11Cl3N2O2 |
|---|---|
| Molecular Weight | 333.59800 |
| Exact Mass | 331.98900 |
| PSA | 69.96000 |
| LogP | 3.75938 |
| InChIKey | WVTPJHNTWSRUIZ-UHFFFAOYSA-N |
| SMILES | CC(=O)c1cc(C)c(C)c(C#N)c1NC(=O)C(Cl)(Cl)Cl |
|
~99%
N-(6-acetyl-2-c... CAS#:89638-38-0 |
| Literature: Fatmi, Aqeel A.; Vaidya, Niteen A.; Iturrian, W. B.; Blanton, C. DeWitt Journal of Medicinal Chemistry, 1984 , vol. 27, # 6 p. 772 - 778 |
|
~%
N-(6-acetyl-2-c... CAS#:89638-38-0 |
| Literature: Fatmi, Aqeel A.; Vaidya, Niteen A.; Iturrian, W. B.; Blanton, C. DeWitt Journal of Medicinal Chemistry, 1984 , vol. 27, # 6 p. 772 - 778 |