1-(bromomethyl)-2-iodo-4-nitro-benzene structure
|
Common Name | 1-(bromomethyl)-2-iodo-4-nitro-benzene | ||
|---|---|---|---|---|
| CAS Number | 89642-21-7 | Molecular Weight | 341.92900 | |
| Density | 2.237g/cm3 | Boiling Point | 377ºC at 760 mmHg | |
| Molecular Formula | C7H5BrINO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 181.8ºC | |
| Name | 1-(bromomethyl)-2-iodo-4-nitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 2.237g/cm3 |
|---|---|
| Boiling Point | 377ºC at 760 mmHg |
| Molecular Formula | C7H5BrINO2 |
| Molecular Weight | 341.92900 |
| Flash Point | 181.8ºC |
| Exact Mass | 340.85500 |
| PSA | 45.82000 |
| LogP | 3.61750 |
| Index of Refraction | 1.689 |
| InChIKey | CSGDIBWHUNXCJM-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(CBr)c(I)c1 |
|
~%
1-(bromomethyl)... CAS#:89642-21-7 |
| Literature: Bacon; Lindsay Journal of the Chemical Society, 1958 , p. 1375,1378 |
| Precursor 1 | |
|---|---|
| DownStream 2 | |
| 2-Jod-4-nitro-benzylbromid |
| 2-iodo-4-nitro-benzyl bromide |