2-(1-oxo-2,3-dihydropyrrolo[1,2-a]indol-4-yl)acetic acid
![2-(1-oxo-2,3-dihydropyrrolo[1,2-a]indol-4-yl)acetic acid Structure](https://image.chemsrc.com/caspic/099/89650-73-7.png)
2-(1-oxo-2,3-dihydropyrrolo[1,2-a]indol-4-yl)acetic acid structure
|
Common Name | 2-(1-oxo-2,3-dihydropyrrolo[1,2-a]indol-4-yl)acetic acid | ||
|---|---|---|---|---|
| CAS Number | 89650-73-7 | Molecular Weight | 229.23100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H11NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(1-oxo-2,3-dihydropyrrolo[1,2-a]indol-4-yl)acetic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H11NO3 |
|---|---|
| Molecular Weight | 229.23100 |
| Exact Mass | 229.07400 |
| PSA | 59.30000 |
| LogP | 1.85480 |
| InChIKey | GHVZVMFRGOZYFC-UHFFFAOYSA-N |
| SMILES | O=C(O)Cc1c2n(c3ccccc13)C(=O)CC2 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
2-(1-oxo-2,3-di... CAS#:89650-73-7 |
| Literature: Ban, Yoshio; Yoshida, Kiyoshi; Goto, Jiro; Oishi, Takeshi; Takeda, Eiko; Ishigamori Tetrahedron, 1983 , vol. 39, # 22 p. 3657 - 3668 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 2-(1-oxo-2,3-dihydropyrrolo[1,2-a]indol-4-yl)acetic acid? |
| A: Molecular weight of 2-(1-oxo-2,3-dihydropyrrolo[1,2-a]indol-4-yl)acetic acid is 229.23100. |
| Q: What is the polar surface area (PSA) of 2-(1-oxo-2,3-dihydropyrrolo[1,2-a]indol-4-yl)acetic acid? |
| A: Polar surface area (PSA) of 2-(1-oxo-2,3-dihydropyrrolo[1,2-a]indol-4-yl)acetic acid is 59.30000. |
| Q: What is the molecular formula of 2-(1-oxo-2,3-dihydropyrrolo[1,2-a]indol-4-yl)acetic acid? |
| A: Molecular formula of 2-(1-oxo-2,3-dihydropyrrolo[1,2-a]indol-4-yl)acetic acid is C13H11NO3. |
| Q: What is the SMILES notation of 2-(1-oxo-2,3-dihydropyrrolo[1,2-a]indol-4-yl)acetic acid? |
| A: SMILES notation of 2-(1-oxo-2,3-dihydropyrrolo[1,2-a]indol-4-yl)acetic acid is O=C(O)Cc1c2n(c3ccccc13)C(=O)CC2. |
| Q: What is the InChIKey of 2-(1-oxo-2,3-dihydropyrrolo[1,2-a]indol-4-yl)acetic acid? |
| A: InChIKey of 2-(1-oxo-2,3-dihydropyrrolo[1,2-a]indol-4-yl)acetic acid is GHVZVMFRGOZYFC-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 89650-73-7? |
| A: Chinese name of 89650-73-7 is 89650-73-7. |
| Q: What is the English name of 2-(1-oxo-2,3-dihydropyrrolo[1,2-a]indol-4-yl)acetic acid? |
| A: The English name of 2-(1-oxo-2,3-dihydropyrrolo[1,2-a]indol-4-yl)acetic acid is 2-(1-oxo-2,3-dihydropyrrolo[1,2-a]indol-4-yl)acetic acid. |
| Q: What is the LogP of 2-(1-oxo-2,3-dihydropyrrolo[1,2-a]indol-4-yl)acetic acid? |
| A: LogP of 2-(1-oxo-2,3-dihydropyrrolo[1,2-a]indol-4-yl)acetic acid is 1.85480. |
| Q: What is the CAS number of 2-(1-oxo-2,3-dihydropyrrolo[1,2-a]indol-4-yl)acetic acid? |
| A: CAS number of 2-(1-oxo-2,3-dihydropyrrolo[1,2-a]indol-4-yl)acetic acid is 89650-73-7. |