3-bromo-5-chloro-2,6-dimethoxybenzoyl chloride
3-bromo-5-chloro-2,6-dimethoxybenzoyl chloride structure
|
Common Name | 3-bromo-5-chloro-2,6-dimethoxybenzoyl chloride | ||
|---|---|---|---|---|
| CAS Number | 89653-83-8 | Molecular Weight | 313.96000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H7BrCl2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-bromo-5-chloro-2,6-dimethoxybenzoyl chloride |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H7BrCl2O3 |
|---|---|
| Molecular Weight | 313.96000 |
| Exact Mass | 311.89600 |
| PSA | 35.53000 |
| LogP | 3.49870 |
| InChIKey | MYQYCWVTGUHWRT-UHFFFAOYSA-N |
| SMILES | COc1c(Cl)cc(Br)c(OC)c1C(=O)Cl |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
3-bromo-5-chlor... CAS#:89653-83-8 |
| Literature: Florvall, Lennart; Oegren, Sven-Ove Journal of Medicinal Chemistry, 1982 , vol. 25, # 11 p. 1280 - 1286 |
|
~%
3-bromo-5-chlor... CAS#:89653-83-8 |
| Literature: Florvall, Lennart; Oegren, Sven-Ove Journal of Medicinal Chemistry, 1982 , vol. 25, # 11 p. 1280 - 1286 |
|
~%
3-bromo-5-chlor... CAS#:89653-83-8 |
| Literature: Florvall, Lennart; Oegren, Sven-Ove Journal of Medicinal Chemistry, 1982 , vol. 25, # 11 p. 1280 - 1286 |
|
~%
3-bromo-5-chlor... CAS#:89653-83-8 |
| Literature: Florvall, Lennart; Oegren, Sven-Ove Journal of Medicinal Chemistry, 1982 , vol. 25, # 11 p. 1280 - 1286 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Benzoyl chloride,3-bromo-5-chloro-2,6-dimethoxy |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What English synonyms does 3-bromo-5-chloro-2,6-dimethoxybenzoyl chloride have? |
| A: English synonyms of 3-bromo-5-chloro-2,6-dimethoxybenzoyl chloride: Benzoyl chloride,3-bromo-5-chloro-2,6-dimethoxy. |
| Q: What is the molecular formula of 3-bromo-5-chloro-2,6-dimethoxybenzoyl chloride? |
| A: Molecular formula of 3-bromo-5-chloro-2,6-dimethoxybenzoyl chloride is C9H7BrCl2O3. |
| Q: What is the molecular weight of 3-bromo-5-chloro-2,6-dimethoxybenzoyl chloride? |
| A: Molecular weight of 3-bromo-5-chloro-2,6-dimethoxybenzoyl chloride is 313.96000. |
| Q: What is the LogP of 3-bromo-5-chloro-2,6-dimethoxybenzoyl chloride? |
| A: LogP of 3-bromo-5-chloro-2,6-dimethoxybenzoyl chloride is 3.49870. |
| Q: What is the Chinese name of 89653-83-8? |
| A: Chinese name of 89653-83-8 is 89653-83-8. |
| Q: What is the SMILES notation of 3-bromo-5-chloro-2,6-dimethoxybenzoyl chloride? |
| A: SMILES notation of 3-bromo-5-chloro-2,6-dimethoxybenzoyl chloride is COc1c(Cl)cc(Br)c(OC)c1C(=O)Cl. |
| Q: What is the InChIKey of 3-bromo-5-chloro-2,6-dimethoxybenzoyl chloride? |
| A: InChIKey of 3-bromo-5-chloro-2,6-dimethoxybenzoyl chloride is MYQYCWVTGUHWRT-UHFFFAOYSA-N. |
| Q: What is the polar surface area (PSA) of 3-bromo-5-chloro-2,6-dimethoxybenzoyl chloride? |
| A: Polar surface area (PSA) of 3-bromo-5-chloro-2,6-dimethoxybenzoyl chloride is 35.53000. |
| Q: What is the English name of 3-bromo-5-chloro-2,6-dimethoxybenzoyl chloride? |
| A: The English name of 3-bromo-5-chloro-2,6-dimethoxybenzoyl chloride is 3-bromo-5-chloro-2,6-dimethoxybenzoyl chloride. |
| Q: What is the CAS number of 3-bromo-5-chloro-2,6-dimethoxybenzoyl chloride? |
| A: CAS number of 3-bromo-5-chloro-2,6-dimethoxybenzoyl chloride is 89653-83-8. |