3,5-dibromo-2,6-dimethoxybenzoyl chloride
3,5-dibromo-2,6-dimethoxybenzoyl chloride structure
|
Common Name | 3,5-dibromo-2,6-dimethoxybenzoyl chloride | ||
|---|---|---|---|---|
| CAS Number | 89653-84-9 | Molecular Weight | 358.41100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H7Br2ClO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3,5-dibromo-2,6-dimethoxybenzoyl chloride |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H7Br2ClO3 |
|---|---|
| Molecular Weight | 358.41100 |
| Exact Mass | 355.84500 |
| PSA | 35.53000 |
| LogP | 3.60780 |
| InChIKey | IQZUBJDPGNLIKR-UHFFFAOYSA-N |
| SMILES | COc1c(Br)cc(Br)c(OC)c1C(=O)Cl |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
3,5-dibromo-2,6... CAS#:89653-84-9 |
| Literature: Florvall, Lennart; Oegren, Sven-Ove Journal of Medicinal Chemistry, 1982 , vol. 25, # 11 p. 1280 - 1286 |
|
~%
3,5-dibromo-2,6... CAS#:89653-84-9 |
| Literature: Pudleiner, Heinz; Laatsch, Hartmut Liebigs Annalen der Chemie, 1990 , # 5 p. 423 - 432 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2,6-dimethoxy-3,5-dibromobenzoyl chloride |
| Benzoyl chloride,3,5-dibromo-2,6-dimethoxy |
| 3,5-Dibrom-2,6-dimethoxybenzoesaeurechlorid |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of 3,5-dibromo-2,6-dimethoxybenzoyl chloride? |
| A: LogP of 3,5-dibromo-2,6-dimethoxybenzoyl chloride is 3.60780. |
| Q: What is the molecular formula of 3,5-dibromo-2,6-dimethoxybenzoyl chloride? |
| A: Molecular formula of 3,5-dibromo-2,6-dimethoxybenzoyl chloride is C9H7Br2ClO3. |
| Q: What is the molecular weight of 3,5-dibromo-2,6-dimethoxybenzoyl chloride? |
| A: Molecular weight of 3,5-dibromo-2,6-dimethoxybenzoyl chloride is 358.41100. |
| Q: What is the InChIKey of 3,5-dibromo-2,6-dimethoxybenzoyl chloride? |
| A: InChIKey of 3,5-dibromo-2,6-dimethoxybenzoyl chloride is IQZUBJDPGNLIKR-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 3,5-dibromo-2,6-dimethoxybenzoyl chloride? |
| A: SMILES notation of 3,5-dibromo-2,6-dimethoxybenzoyl chloride is COc1c(Br)cc(Br)c(OC)c1C(=O)Cl. |
| Q: What is the English name of 3,5-dibromo-2,6-dimethoxybenzoyl chloride? |
| A: The English name of 3,5-dibromo-2,6-dimethoxybenzoyl chloride is 3,5-dibromo-2,6-dimethoxybenzoyl chloride. |
| Q: What English synonyms does 3,5-dibromo-2,6-dimethoxybenzoyl chloride have? |
| A: English synonyms of 3,5-dibromo-2,6-dimethoxybenzoyl chloride: 2,6-dimethoxy-3,5-dibromobenzoyl chloride, Benzoyl chloride,3,5-dibromo-2,6-dimethoxy, 3,5-Dibrom-2,6-dimethoxybenzoesaeurechlorid. |
| Q: What is the polar surface area (PSA) of 3,5-dibromo-2,6-dimethoxybenzoyl chloride? |
| A: Polar surface area (PSA) of 3,5-dibromo-2,6-dimethoxybenzoyl chloride is 35.53000. |
| Q: What is the CAS number of 3,5-dibromo-2,6-dimethoxybenzoyl chloride? |
| A: CAS number of 3,5-dibromo-2,6-dimethoxybenzoyl chloride is 89653-84-9. |
| Q: What is the Chinese name of 89653-84-9? |
| A: Chinese name of 89653-84-9 is 89653-84-9. |